
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1260682-15-2 |
| Catalog No. | 2A-1173903 |
| Chinese Name | (2,4,6-三氯嘧啶-5-基)甲醇 |
| Synonyms | MFCD11870608 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.237 |
| Storage Condition | room temperature |
| HTC | 2933599090 |
| PubChem ID | 163851962 |
| MDL Number | MFCD00228160 |
| SMILES | OCc1c(Cl)nc(Cl)nc1Cl |
| InChI | InChI=1S/C5H3Cl3N2O/c6-3-2(1-11)4(7)10-5(8)9-3/h11H,1H2 |
| InChI Key | FBNRIAWXHJFJAS-UHFFFAOYSA-N |
| MSDS | msds/174235_1_1260682_15_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| toluene-4-sulfonic acid 1-acetyl-3,3,3-trifluoro-2-oxo-propyl ester | 1377581-59-3 | 2A-1173501 |
| 1,1-BIS(4-BIS(4-METHYLPHENYL)AMINOPHENYL)CYCLOHEXANE | 1174006-36-0 | 2A-1173513 |
| toluene-4-sulfonic acid 2-vinyloxy-ethyl ester | 99051-18-0 | 2A-1173569 |
| O-(2-(p-toluenesulfonyloxy)ethyl)-N-hydroxyphthalimide | 173278-76-7 | 2A-1173570 |
| 2,2,5-TriMethyl-4-phenyl-3-azahexane-3-nitroxide | 61015-94-9 | 2A-1173676 |
| 1H-Imidazolium, 1-ethenyl-1 (or 3)-methyl-, methyl sulfate, homopolymer | 31855-14-8 | 2A-1174021 |
| PERFLUORO(METHYLCYCLOHEXANE) | 355-02-2 | 2A-1174036 |
| (1-ethyl-1H-benzoimidazol-2-yl)methanol | 21269-78-3 | 2A-1174078 |
| 2-(1H-indol-2-yl)ethanol | 52098-05-2 | 2A-1174106 |
| Siloxanes and Silicones, di-Me, polymers with 3-(2-aminoethyl)aminopropyl silsesquioxanes, hydroxy-terminatedChemicalBook | 68554-54-1 | 2A-1174128 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA