
CAS Number85-29-0
Synonyms(2-chlorophenyl)-(4-chlorophenyl)methanone; EINECS 201-596-7; (2-Chlorophenyl)(4-chlorophenyl)methanone; 2,4'-Dichlorobenzophenone; MFCD00038744
Molecular FormulaC13H8O1Cl2
Molecular Weight251.11
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point367.2±22.0 °C at 760 mmHg
Melting Point64°C
Appearancewhite crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 85-29-0 |
| Catalog No. | 2A-9017438 |
| Chinese Name | 2,4'-二氯苯甲酮 |
| Synonyms | (2-chlorophenyl)-(4-chlorophenyl)methanone; EINECS 201-596-7; (2-Chlorophenyl)(4-chlorophenyl)methanone; 2,4'-Dichlorobenzophenone; MFCD00038744 |
| Molecular Formula | C13H8O1Cl2 |
| Molecular Weight | 251.11 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 367.2±22.0 °C at 760 mmHg |
| Melting Point | 64°C |
| Appearance | white crystal powder |
| Storage Condition | Room temperature, dry |
| HTC | 2914700090 |
| MDL Number | MFCD00038744 |
| SMILES | O=C(c1ccc(Cl)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C13H8Cl2O/c14-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)15/h1-8H |
| InChI Key | YXMYPHLWXBXNFF-UHFFFAOYSA-N |
| MSDS | msds/17438_1_85_29_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dinonyl phthalate | 84-76-4 | 2A-9017424 |
| Naphthionic acid | 84-86-6 | 2A-9017428 |
| 5-Amino-1-naphthalenesulfonic acid | 84-89-9 | 2A-9017431 |
| Trimeprazine | 84-96-8 | 2A-9017432 |
| Phenanthrene | 85-01-8 | 2A-9017434 |
| 5'-Guanylic acid | 85-32-5 | 2A-9017439 |
| Acetrizoic acid | 85-36-9 | 2A-9017440 |
| 3-Nitrosalicylic acid | 85-38-1 | 2A-9017441 |
| Tetrahydrophthalimide | 85-40-5 | 2A-9017442 |
| 1-Naphthalenesulfonic acid | 85-47-2 | 2A-9017448 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA