
CAS Number84-96-8
SynonymsMethylpromazine; Isobutrazine; EINECS 201-577-3; Repetin; Alimemazine; N,N-dimethyl-N-<2-methyl-3-(10H-10-phenothiazinyl)propyl>amine; Alimezine; dl-Trimeprazine; Teralen; 10-[3-(dimethylamino)-2-methylpropyl]phenothiazine; Trimeprazine
Molecular FormulaC18H22N2S
Molecular Weight373.49
Purity98.00%
Density1.203 g/cm3
Boiling Point420.3ºC at 760mmHg
Melting Point68°C
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 84-96-8 |
| Catalog No. | 2A-9017432 |
| Chinese Name | 异丁嗪 |
| Synonyms | Methylpromazine; Isobutrazine; EINECS 201-577-3; Repetin; Alimemazine; N,N-dimethyl-N-<2-methyl-3-(10H-10-phenothiazinyl)propyl>amine; Alimezine; dl-Trimeprazine; Teralen; 10-[3-(dimethylamino)-2-methylpropyl]phenothiazine; Trimeprazine |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 373.49 |
| Purity | 98.00 |
| Density | 1.203 g/cm3 |
| Boiling Point | 420.3ºC at 760mmHg |
| Melting Point | 68°C |
| Water Solubility | 0.942 mg/L |
| Storage Condition | The warehouse is ventilated and dried at low tempe |
| Packaging | II |
| Application | Alimemazine is a phenothiazine derivative commonly used as an antipruritic agent and an antagonist of the hemagglutinin (HA)-receptor. Alimemazine (Trimeprazine) is a partial agonist at the histamine |
| MDL Number | MFCD00242594 |
| SMILES | S4c5c(cccc5)N(c6c4cccc6)CC(CN(C)C)C.S1c2c(cccc2)N(c3c1cccc3)CC(CN(C)C)C.O[C@H]([C@@H](O)C(=O)O)C(=O)O |
| InChI | 1S/2C18H22N2S.C4H6O6/c2*1-14(12-19(2)3)13-20-15-8-4-6-10-17(15)21-18-11-7-5-9-16(18)20;5-1(3(7)8)2(6)4(9)10/h2*4-11,14H,12-13H2,1-3H3;1-2,5-6H,(H,7,8)(H,9,10)/t;;1-,2-/m..1/s1 |
| InChI Key | AJZJIYUOOJLBAU-CEAXSRTFSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| Hazard Symbols | 6.1(a) |
| MSDS | msds/17432_1_84_96_8.pdf |
| Transport Info | Product Name: Alimemazine |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,2'-Dimethyl[1,1'-biphenyl]-4,4'-diamine | 84-67-3 | 2A-9017421 |
| Diisobutyl phthalate | 84-69-5 | 2A-9017422 |
| Dinonyl phthalate | 84-76-4 | 2A-9017424 |
| Naphthionic acid | 84-86-6 | 2A-9017428 |
| 5-Amino-1-naphthalenesulfonic acid | 84-89-9 | 2A-9017431 |
| Phenanthrene | 85-01-8 | 2A-9017434 |
| 2,4'-Dichlorobenzophenone | 85-29-0 | 2A-9017438 |
| 5'-Guanylic acid | 85-32-5 | 2A-9017439 |
| Acetrizoic acid | 85-36-9 | 2A-9017440 |
| 3-Nitrosalicylic acid | 85-38-1 | 2A-9017441 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA