
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 942206-07-7 |
| Catalog No. | 2A-1173987 |
| Chinese Name | 2-溴-5-碘-4-甲基吡啶 |
| Synonyms | 2-Bromo-5-iodo-4-picoline; 2-Bromo-5-iodo-4-methylpyridine; T6NJ BE D1 EI |
| Molecular Formula | C6H5N1Br1I1 |
| Molecular Weight | 297.92 |
| Density | 2.2±0.1 g/cm3 |
| Boiling Point | 300.8±37.0 °C at 760 mmHg |
| Melting Point | 50-52°C |
| Storage Condition | 2-8°C |
| HTC | 2933399090 |
| PubChem ID | 74311321 |
| MDL Number | MFCD09037465 |
| SMILES | Cc1cc(Br)ncc1I |
| InChI | InChI=1S/C6H5BrIN/c1-4-2-6(7)9-3-5(4)8/h2-3H,1H3 |
| InChI Key | DASWHKVFPFHYSZ-UHFFFAOYSA-N |
| MSDS | msds/174321_1_942206_07_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 7,8-DiMethylquinoline | 20668-35-3 | 2A-1173958 |
| 1-METHYL-2-PHENYL-1H-PYRROLE | 938-37-4 | 2A-1173969 |
| 2-chloro-7-iodo-5-Methyl-5H-pyrrolo[3,2-d]pyriMidine | 1152475-62-1 | 2A-1173973 |
| 3-(2-Methoxy-4-phenylamino-phenylsulfamoyl)-thiophene-2-carboxylic acid methyl ester | 1014691-61-2 | 2A-1173979 |
| (7S)-1′-{[5-(trifluoromethyl)furan-2-yl]methyl}spiro[furo[2,3-f][1,3]benzodioxole-7,3′-indol]-2′(1′H)-one | 1259933-16-8 | 2A-1173981 |
| 2-Hydroxy-5-iodo-3-nitropyridine | 25391-59-7 | 2A-1174000 |
| Pyridine, 2-[(difluoroMethyl)sulfonyl]- | 1219454-89-3 | 2A-1174004 |
| 1-[(trifluoromethyl)thio]-2,5-Pyrrolidinedione | 183267-04-1 | 2A-1174006 |
| 3-bromopyridine-2,5-diamine | 896160-69-3 | 2A-1174039 |
| 4-bromo-3-chloro-5-nitropyridine | 1072141-30-0 | 2A-1174040 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA