
CAS Number79-77-6
Synonyms(3E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-one; 4-(2,6,6-Trimethyl-1-cyclohexenyl)-3-buten-2-one; (3E)-4-(2,6,6-Trimethyl-2-cyclohexen-1-yl)-3-buten-2-one; MFCD00001549; EINECS 201-224-3; (E)-4-(2,6,6-Trimethyl-2-cyclohexen-1-yl)-3-buten-2-one; IONONE,B; OIL; beta-ionone; B-IONONE
Molecular FormulaC13H20O
Molecular Weight192.30
Purity≥97.0 (GC)%
Density0.9±0.1 g/cm3
Boiling Point257.6±0.0 °C at 760 mmHg
Melting Point-49°C
AppearanceColorless to light yellow liquid
EINECS201-224-3
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 79-77-6 |
| Catalog No. | 2A-9017284 |
| Chinese Name | Beta-紫罗酮 |
| Synonyms | (3E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-one; 4-(2,6,6-Trimethyl-1-cyclohexenyl)-3-buten-2-one; (3E)-4-(2,6,6-Trimethyl-2-cyclohexen-1-yl)-3-buten-2-one; MFCD00001549; EINECS 201-224-3; (E)-4-(2,6,6-Trimethyl-2-cyclohexen-1-yl)-3-buten-2-one; IONONE,B; OIL; beta-ionone; B-IONONE |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 |
| Purity | ≥97.0 (GC) |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 257.6±0.0 °C at 760 mmHg |
| Melting Point | -49°C |
| Appearance | Colorless to light yellow liquid |
| Storage Condition | 2-8°C, cool and ventilated place Packed in galvani |
| EINECS | 201-224-3 |
| PubChem ID | 329769996 |
| MDL Number | MFCD00001549 |
| SMILES | O=C(C)\C=C\C1=C(CCCC1(C)C)C |
| InChI | 1S/C13H20O/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h7-8H,5-6,9H2,1-4H3/b8-7+ |
| InChI Key | PSQYTAPXSHCGMF-BQYQJAHWSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 77101502 |
| MSDS | msds/17284_1_79_77_6.pdf |
| Transport Info | Product name: β-ionone |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Mercaptopropionic acid | 79-42-5 | 2A-9017276 |
| Dichloroacetic acid | 79-43-6 | 2A-9017277 |
| 2-Nitropropane | 79-46-9 | 2A-9017279 |
| DL-Pantolactone | 79-50-5 | 2A-9017280 |
| 2,5-Di(tert-amyl)hydroquinone | 79-74-3 | 2A-9017283 |
| 2,2-Bis(4-hydroxy-3-methylphenyl)propane | 79-97-0 | 2A-9017289 |
| Sulfenone | 80-00-2 | 2A-9017290 |
| 4,4'-Isopropylidenedicyclohexanol | 80-04-6 | 2A-9017291 |
| 4,4'-Dichlorodiphenyl sulfone | 80-07-9 | 2A-9017293 |
| 4,4'-Diaminodiphenylsulfone | 80-08-0 | 2A-9017294 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA