
CAS Number78454-17-8
SynonymsOrmosin VI; 10-Desacetyl-7-epipaclitaxel; 10-Deacetyl-7-epi-taxol; 7-Epi-10-deacetyltaxol; 7-Epi 10-Desacetyl Paclitaxel; CS-1143; 10-Deacetyl-7-epi-paclitaxel; 7-Epi-10-deacetyl-taxol
Molecular FormulaC45H49NO13
Molecular Weight811.86900
Purity98%%
Density1.41±0.1 g/cm3 (20 ºC 760 Torr)
Boiling Point959.5℃ at 760 mmHg
Melting Point163-170?C
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 78454-17-8 |
| Catalog No. | 2A-1172529 |
| Chinese Name | 7-表-10-去乙酰紫杉醇 |
| Synonyms | Ormosin VI; 10-Desacetyl-7-epipaclitaxel; 10-Deacetyl-7-epi-taxol; 7-Epi-10-deacetyltaxol; 7-Epi 10-Desacetyl Paclitaxel; CS-1143; 10-Deacetyl-7-epi-paclitaxel; 7-Epi-10-deacetyl-taxol |
| Molecular Formula | C45H49NO13 |
| Molecular Weight | 811.86900 |
| Purity | 98% |
| Density | 1.41±0.1 g/cm3 (20 ºC 760 Torr) |
| Boiling Point | 959.5℃ at 760 mmHg |
| Melting Point | 163-170?C |
| Appearance | powder |
| Water Solubility | Insuluble (2.4E-4 g/L) (25 ºC) |
| Storage Condition | -20°C Freezer, Under Inert Atmosphere |
| Application | 7-Epi 10-desacetyl paclitaxel (7-epi-10-deacetyltaxol) is a paclitaxel derivative that is cytotoxic to HeLa cells with an IC50 value of 85 μM. |
| PubChem ID | 97189583 |
| SMILES | CC(=O)OC12COC1CC(O)C1(C)C(=O)C(O)C3=C(C)C(OC(=O)C(O)C(NC(=O)c4ccccc4)c4ccccc4)CC(O)(C(OC(=O)c4ccccc4)C21)C3(C)C |
| InChI | InChI=1S/C45H49NO13/c1-24-29(57-41(54)35(50)33(26-15-9-6-10-16-26)46-39(52)27-17-11-7-12-18-27)22-45(55)38(58-40(53)28-19-13-8-14-20-28)36-43(5,37(51)34(49)32(24)42(45,3)4)30(48)21-31-44(36,23-56-31)59-25(2)47/h6-20,29-31,33-36,38,48-50,55H,21-23H2,1-5H3,(H,46,52)/t29-,30+,31+,33-,34+,35+,36-,38-,43+,44-,45+/m0/s1 |
| InChI Key | TYLVGQKNNUHXIP-DIYBZAJCSA-N |
| Transport Info | Product name: 7-epi-10-desacetyl paclitaxel |
| Related Products in Alkaloids | ||
|---|---|---|
| 7-Epitaxol | 105454-04-4 | 2A-1170148 |
| SANGUINARINE (RG) | 92545-30-7 | 2A-1170446 |
| platyphylline | 480-78-4 | 2A-1170811 |
| L-N-METHYLEPHEDRINE HYDROCHLORIDE | 38455-90-2 | 2A-1171310 |
| ACETYLTAXOL, 7-(P) | 92950-39-5 | 2A-1172526 |
| THEBAINE | 115-37-7 | 2A-1173257 |
| (-)-COTININE | 486-56-6 | 2A-1174024 |
| HYDROQUININE (ANTHRAQUINONE-1 4-DIYL) | 176097-24-8 | 2A-3174501 |
| Cephaeline Hydrochloride | 5853-29-2 | 2A-3177034 |
| 4-Ethylmethcathinone | 1225622-14-9 | 2A-4177112 |
| Browse all Alkaloids products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA