
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6754-13-8 |
| Catalog No. | 2A-1172241 |
| Chinese Name | 心菊内酯 |
| Synonyms | dl-Mexicanin I; Helenalin A; HELENALIN; PF 56 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30100 |
| Purity | 98% |
| Density | 1.25g/cm3 |
| Boiling Point | 473ºC at 760 mmHg |
| Melting Point | 167-168ºC |
| Appearance | solid |
| Storage Condition | 2-8°C, sealed, dry |
| Packaging | III |
| Application | Helenalin is an anti-inflammatory sesquiterpene lactone. Helenalin selectively inhibits the transcription factor NF-κB by directly targeting p65. Helenalin has alkylating activity and targets the cyst |
| PubChem ID | 11664 |
| SMILES | C=C1C(=O)OC2CC(C)C3C=CC(=O)C3(C)C(O)C12 |
| InChI | InChI=1S/C15H18O4/c1-7-6-10-12(8(2)14(18)19-10)13(17)15(3)9(7)4-5-11(15)16/h4-5,7,9-10,12-13,17H,2,6H2,1,3H3/t7-,9+,10-,12-,13+,15+/m1/s1 |
| InChI Key | ZVLOPMNVFLSSAA-XEPQRQSNSA-N |
| Hazard Symbols | 6.1(b) |
| Transport Info | Product name: Helenalin |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N1,N5-Dibutyl-N2-(2-ethylhexanoyl)-L-glutamamide | 486455-65-6 | 2A-1172232 |
| D-PSICOSE | 551-68-8 | 2A-1172234 |
| LITHIUM ACETYLACETONATE | 18115-70-3 | 2A-1172237 |
| bupivacaine hydrochloride | 18010-40-7 | 2A-1172238 |
| 1-Ethyl-3-methylimidazolium trifluoromethanesulfonate | 145022-44-2 | 2A-1172239 |
| L-SERINE-15N | 59935-32-9 | 2A-1172242 |
| 4-BIS(TRIETHOXYSILYL)BENZENE 96 | 2615-18-1 | 2A-1172247 |
| Mirodenafil Dihydrochloride | 862189-96-6 | 2A-1172249 |
| 6-(diaminomethylideneamino)hexanoic acid | 72198-14-2 | 2A-1172250 |
| INNO206 | 1361644-26-9 | 2A-1172252 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA