
CAS Number37138-82-2
Synonyms2,4-dichloro-6-nitroanisole; 2,4-dicloro-6-nitroanisole; 2,6-Dichloro-4-nitrophenyl methyl ether; 1,3-Dichloro-2-methoxy-5-nitrobenzene; 2,4-Dichlor-6-nitro-anisol; 4,6-Dichloro-2-nitrophenol-methylaether; Benzene,1,5-dichloro-2-methoxy-3-nitro; 2,4,5-TRIFLUOROBENZESULFONAMIDE
Molecular FormulaC7H5Cl2NO3
Molecular Weight222.025
Density1.5±0.1 g/cm3
Boiling Point305.6±37.0 °C at 760 mmHg
AppearanceLight yellow to yellow solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 37138-82-2 |
| Catalog No. | 2A-1171632 |
| Chinese Name | 1,5-二氯-2-甲氧基-3-硝基苯 |
| Synonyms | 2,4-dichloro-6-nitroanisole; 2,4-dicloro-6-nitroanisole; 2,6-Dichloro-4-nitrophenyl methyl ether; 1,3-Dichloro-2-methoxy-5-nitrobenzene; 2,4-Dichlor-6-nitro-anisol; 4,6-Dichloro-2-nitrophenol-methylaether; Benzene,1,5-dichloro-2-methoxy-3-nitro; 2,4,5-TRIFLUOROBENZESULFONAMIDE |
| Molecular Formula | C7H5Cl2NO3 |
| Molecular Weight | 222.025 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 305.6±37.0 °C at 760 mmHg |
| Appearance | Light yellow to yellow solid |
| Storage Condition | room temperature |
| HTC | 2909309090 |
| PubChem ID | 24519680 |
| SMILES | COc1c(Cl)cc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5Cl2NO3/c1-13-7-5(9)2-4(8)3-6(7)10(11)12/h2-3H,1H3 |
| InChI Key | OQRXLBNJKPMELG-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 5-Ethoxy-3H-1,2,4-dithiazol-3-one | 178318-21-3 | 2A-1171545 |
| Trans-1-[4-(4-heptylcyclohexyl)phenoxy]-2,4-dinitro benzene | 194939-20-3 | 2A-1171591 |
| N-(2,4-dinitro-phenyl)-4-(4- heptyl-cyclohexyl)-benzaMide | 2A-1171592 | 2A-1171592 |
| N-(2,4-dinitro-phenyl)-4-(4- pentyl-cyclohexyl)-benzaMide | 2A-1171593 | 2A-1171593 |
| (1S)-2-CHLORO-1-(2,4-DIFLUOROPHENYL)ETHANOL | 330156-49-5 | 2A-1171619 |
| Flupyradifurone | 951659-40-8 | 2A-1171652 |
| 5-amino-2,4-di-tert-butylphenyl methyl carbonate | 1182822-32-6 | 2A-1171696 |
| 2β,4α-Dimethyloxetane | 14988-66-0 | 2A-1171703 |
| 2,4-DIBROMOMESITYLENE | 6942-99-0 | 2A-1171721 |
| 3,5-DIFLUORO-2,4-DIHYDROXYBENZALDEHYDE | 209541-27-5 | 2A-1171893 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA