
CAS Number430-67-1
Synonyms2,2-difluoroethaneamine; MFCD00798137; 2,2-difluoro-ethylamine; Z1YFF; CF2HCH2NH2; 2-Amino-1,1-difluoroethane; Ethylamine,2,2-difluoro; 2,2-difluoroethanaminium; 2,2-Difluoroethanamine; 1-Amino-2,2-difluoroethane; 2,2-Difluoroethan-1-amine; 2,2-Difluor-aethylamin; 2,2-Difluoroethylamine
Molecular FormulaC2H5F2N
Molecular Weight81.065
Density1.1±0.1 g/cm3
Boiling Point59.4±25.0 °C at 760 mmHg
AppearanceColorless to very faint yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 430-67-1 |
| Catalog No. | 2A-1170784 |
| Chinese Name | 2,2-二氟乙胺 |
| Synonyms | 2,2-difluoroethaneamine; MFCD00798137; 2,2-difluoro-ethylamine; Z1YFF; CF2HCH2NH2; 2-Amino-1,1-difluoroethane; Ethylamine,2,2-difluoro; 2,2-difluoroethanaminium; 2,2-Difluoroethanamine; 1-Amino-2,2-difluoroethane; 2,2-Difluoroethan-1-amine; 2,2-Difluor-aethylamin; 2,2-Difluoroethylamine |
| Molecular Formula | C2H5F2N |
| Molecular Weight | 81.065 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 59.4±25.0 °C at 760 mmHg |
| Appearance | Colorless to very faint yellow liquid |
| Storage Condition | room temperature, sealed |
| HTC | 2921199090 |
| PubChem ID | 3160389 |
| SMILES | NCC(F)F |
| InChI | InChI=1S/C2H5F2N/c3-2(4)1-5/h2H,1,5H2 |
| InChI Key | OVRWUZYZECPJOB-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Selectfluor II | 159269-48-4 | 2A-1170777 |
| 3,3,4,4-Tetrafluorobutan-2-ol | 17425-25-1 | 2A-1170778 |
| 4,4,5,5,5-Pentafluoropentyl methanesulfonate | 252947-01-6 | 2A-1170780 |
| 1,3-Dichloro-2,4,6-trifluoro-5-iodobenzene | 31612-68-7 | 2A-1170781 |
| Lithium tetrakis(pentafluorophenyl)borate’s etherate | 371162-53-7 | 2A-1170783 |
| Ethyl 4,4-difluoropentanoate | 659-72-3 | 2A-1170785 |
| Ethyl 2,2-difluorohexanoate | 74106-81-3 | 2A-1170786 |
| Bromfenac sodium | 91714-93-1 | 2A-1170790 |
| 7-Phenylcarbamoylheptanoic acid | 149648-52-2 | 2A-1170791 |
| 1,4-DIPHENYLBUTANE | 1083-56-3 | 2A-1170770 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA