
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5867-45-8 |
| Catalog No. | 2A-1170661 |
| Chinese Name | 3-乙酰氨基吡啶 |
| Synonyms | N-pyridin-3-ylacetamide |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15100 |
| Purity | 98.00 |
| Density | 1.176g/cm3 |
| Boiling Point | 327ºC |
| Melting Point | 131ºC |
| Appearance | White-off-white crystal-powder |
| Storage Condition | Avoid light, keep in a cool and dry place, sealed |
| HTC | 2933399090 |
| PubChem ID | 474241 |
| SMILES | CC(=O)Nc1cccnc1 |
| InChI | InChI=1S/C7H8N2O/c1-6(10)9-7-3-2-4-8-5-7/h2-5H,1H3,(H,9,10) |
| InChI Key | JVYIBLHBCPSTKF-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Plastic & Specialty Additives | ||
|---|---|---|
| Zolmitriptan | 16275-44-8 | 2A-1169512 |
| Fireguard 910A-62, PVC compound with flame retardants | 2A-1169930 | 2A-1169930 |
| N-[3-[3-Cyclopropyl-5-[(2-fluoro-4-iodophenyl)amino]-3,4,6,7-tetrahydro-6,8-dimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1(2H)-yl]phenyl]acetamide | 871700-17-3 | 2A-1170286 |
| Pardoprunox | 269718-84-5 | 2A-1170351 |
| 3-Azidopropanesulfonyl chloride | 1034192-11-4 | 2A-1170554 |
| carbovir triphosphate | 121864-74-2 | 2A-1170866 |
| Hexaazatriphenylenehexacabonitrile | 105598-27-4 | 2A-1171404 |
| (2,2-diethoxyethyl)triphenylphosphoniuM broMide | 51605-46-0 | 2A-1171599 |
| ((1,3-dioxan-2- yl)methyl)triphenylphosphonium bromide | 2A-1171600 | 2A-1171600 |
| 1-tert-butyl 2-Methyl 4-azidopyrrolidine-1,2-dicarboxylate | 84520-68-3 | 2A-1172048 |
| Browse all Plastic & Specialty Additives products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA