
CAS Number121917-57-5
Synonyms5H-Dibenzo[a,d]cyclohepten-5,10-imine, 10,11-dihydro-5-methyl-, (5S,10R)-, (2Z)-2-butenedioate (1:1); 5H-Dibenzo[a,d]cyclohepten-5,10-imine,10,11-dihydro-5-methyl-,(5R,10S); 5H-Dibenzo[a,d]cyclohepten-5,10-imine, 10,11-dihydro-5-methyl-, (5R,10S)-, (2Z)-2-butenedioate (1:1); (+)-10,11-dihydro-5-methyl-5H-dibenzo[a,d]cyclohepten-5,10-diyldiammonium maleate; DIZOCILPINE MALEATE; (+)-5-Methyl-10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5,10-imine (Z)-2-Butenedioate (1:1); Neurogard; (5S,10R)-5-methyl-10,11-dihydro-5H-5,10-epiminodibenzo[a,d][7]annulene (2Z)-but-2-enedioate (1:1)
Molecular FormulaC20H19NO4
Molecular Weight337.369
Boiling Point320.3ºC at 760 mmHg
Appearancewhite solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 121917-57-5 |
| Catalog No. | 2A-1170266 |
| Chinese Name | (-)-MK-801马来酸盐 |
| Synonyms | 5H-Dibenzo[a,d]cyclohepten-5,10-imine, 10,11-dihydro-5-methyl-, (5S,10R)-, (2Z)-2-butenedioate (1:1); 5H-Dibenzo[a,d]cyclohepten-5,10-imine,10,11-dihydro-5-methyl-,(5R,10S); 5H-Dibenzo[a,d]cyclohepten-5,10-imine, 10,11-dihydro-5-methyl-, (5R,10S)-, (2Z)-2-butenedioate (1:1); (+)-10,11-dihydro-5-methyl-5H-dibenzo[a,d]cyclohepten-5,10-diyldiammonium maleate; DIZOCILPINE MALEATE; (+)-5-Methyl-10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5,10-imine (Z)-2-Butenedioate (1:1); Neurogard; (5S,10R)-5-methyl-10,11-dihydro-5H-5,10-epiminodibenzo[a,d][7]annulene (2Z)-but-2-enedioate (1:1) |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.369 |
| Boiling Point | 320.3ºC at 760 mmHg |
| Appearance | white solid |
| Water Solubility | DMSO: >20 mg/mL |
| Storage Condition | -20℃ |
| Application | (-)-MK 801 Maleate is the enantiomer of (+)-MK-801, a highly selective, selective, and non-competitive NMDA receptor antagonist. |
| PubChem ID | 24277961 |
| SMILES | CC12NC(Cc3ccccc31)c1ccccc12.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C16H15N.C4H4O4/c1-16-13-8-4-2-6-11(13)10-15(17-16)12-7-3-5-9-14(12)16;5-3(6)1-2-4(7)8/h2-9,15,17H,10H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t15-,16+;/m1./s1 |
| InChI Key | QLTXKCWMEZIHBJ-FWHYOZOBSA-N |
| Transport Info | Product name: (-)-Dizocilpine |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| PF-06447475 | 1527473-33-1 | 2A-1170260 |
| SP2509 | 1423715-09-6 | 2A-1170261 |
| Molidustat(BAY 85-3934) | 1154025-82-6 | 2A-1170262 |
| KPT-9294 | 1643913-93-2 | 2A-1170263 |
| (-)-MK-801 MALEATE | 77086-22-7 | 2A-1170265 |
| TAK-063 | 1238697-26-1 | 2A-1170267 |
| SAG | 912545-86-9 | 2A-1170268 |
| SB 239063 | 193551-21-2 | 2A-1170269 |
| BIBX 1382 DIHYDROCHLORIDE | 196612-93-8 | 2A-1170270 |
| GSK J1 | 1343722-53-7 | 2A-1170271 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA