
CAS Number5392-12-1
SynonymsMFCD00004004; EINECS 226-392-5; 2-methoxynaphthalene-1-carbaldehyde; 2-Methoxy-1-Naphthaldehyde
Molecular FormulaC12H10O2
Molecular Weight186.20700
Purity98%
Density1.169g/cm3
Boiling Point205 °C18 mm Hg(lit.)
Melting Point82-85 °C(lit.)
AppearanceBeige-brown crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5392-12-1 |
| Catalog No. | 2A-1169895 |
| Chinese Name | 2-甲氧基-1-萘醛 |
| Synonyms | MFCD00004004; EINECS 226-392-5; 2-methoxynaphthalene-1-carbaldehyde; 2-Methoxy-1-Naphthaldehyde |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.20700 |
| Purity | 98 |
| Density | 1.169g/cm3 |
| Boiling Point | 205 °C18 mm Hg(lit.) |
| Melting Point | 82-85 °C(lit.) |
| Appearance | Beige-brown crystalline powder |
| Storage Condition | Avoid light, keep in a cool and dry place, sealed |
| HTC | 2912499000 |
| PubChem ID | 69773 |
| SMILES | COc1ccc2ccccc2c1C=O |
| InChI | InChI=1S/C12H10O2/c1-14-12-7-6-9-4-2-3-5-10(9)11(12)8-13/h2-8H,1H3 |
| InChI Key | YIQGLTKAOHRZOL-UHFFFAOYSA-N |
| MSDS | msds/170025_2_5392_12_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 99.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| methyl 4-(bromomethyl)-2-fluorobenzoate | 85070-57-1 | 2A-1169761 |
| 2-Methyl-3-trifluoromethylaniline | 54369-44-0 | 2A-1169776 |
| sodium 6-amino-4-hydroxy-5-[[2-(trifluoromethyl)phenyl]azo]naphthalene-2-sulphonate | 67786-14-5 | 2A-1169818 |
| 3-oxocyclopentanecarboxylic acid | 13012-38-9 | 2A-1169884 |
| Pentane-2,3,4-trione 3-phenylhydrazone | 613-45-7 | 2A-1169894 |
| 2-aMino-6-nitrobenzaldehyde | 130133-53-8 | 2A-1169904 |
| 1-(BROMOMETHYL)ADAMANTANE | 14651-42-4 | 2A-1169909 |
| 1,1’-Dimethyl ferrocenedicarboxylate | 2A-1169962 | 2A-1169962 |
| [1R-(1alpha,2beta,5alpha)]-2-(isopropyl)-5-methylcyclohexanecarboxylic acid | 16052-40-7 | 2A-1170090 |
| 2,3,4,9-TETRAHYDRO-1H-BETA-CARBOLINE-3-CARBOXYLIC ACID | 6052-68-2 | 2A-1170117 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA