
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13012-38-9 |
| Catalog No. | 2A-1169884 |
| Chinese Name | (R)-3-酮环戊酸 |
| Synonyms | MFCD19228224 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.12600 |
| Boiling Point | 301°C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2918300090 |
| PubChem ID | 9167328 |
| SMILES | O=C1CCC(C(=O)O)C1 |
| InChI | InChI=1S/C6H8O3/c7-5-2-1-4(3-5)6(8)9/h4H,1-3H2,(H,8,9)/t4-/m1/s1 |
| InChI Key | RDSNBKRWKBMPOP-SCSAIBSYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Hydroxy-4,5-methylenedioxybenzaldehyde | 4720-68-7 | 2A-1169695 |
| ethyl 6-hydroxycyclohex-1-enecarboxylate | 28469-52-5 | 2A-1169754 |
| methyl 4-(bromomethyl)-2-fluorobenzoate | 85070-57-1 | 2A-1169761 |
| 2-Methyl-3-trifluoromethylaniline | 54369-44-0 | 2A-1169776 |
| sodium 6-amino-4-hydroxy-5-[[2-(trifluoromethyl)phenyl]azo]naphthalene-2-sulphonate | 67786-14-5 | 2A-1169818 |
| Pentane-2,3,4-trione 3-phenylhydrazone | 613-45-7 | 2A-1169894 |
| 2-METHOXY-1-NAPHTHALDEHYDE | 5392-12-1 | 2A-1169895 |
| 2-aMino-6-nitrobenzaldehyde | 130133-53-8 | 2A-1169904 |
| 1-(BROMOMETHYL)ADAMANTANE | 14651-42-4 | 2A-1169909 |
| 1,1’-Dimethyl ferrocenedicarboxylate | 2A-1169962 | 2A-1169962 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA