
CAS Number3663-81-8
Synonyms2-benzodioxanylcarbonyl chloride; 1,4-benzodioxane-2-carbonyl chloride; 1,4-BENZODIOXAN-2-CARBONYL CHLORIDE; benzodioxane-2-carboxylic acid; chlorure del' acide benzodioxanne carboxylique-2; BUTTPARK 364-48
Molecular FormulaC9H7ClO3
Molecular Weight198.60300
Purity98%%
Density1.374g/cm3
Boiling Point279.9ºC at 760mmHg
Melting Point56-59ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3663-81-8 |
| Catalog No. | 2A-1169847 |
| Chinese Name | 2,3-二氢-1,4-苯并二恶烷-2-羰酰氯 |
| Synonyms | 2-benzodioxanylcarbonyl chloride; 1,4-benzodioxane-2-carbonyl chloride; 1,4-BENZODIOXAN-2-CARBONYL CHLORIDE; benzodioxane-2-carboxylic acid; chlorure del' acide benzodioxanne carboxylique-2; BUTTPARK 364-48 |
| Molecular Formula | C9H7ClO3 |
| Molecular Weight | 198.60300 |
| Purity | 98% |
| Density | 1.374g/cm3 |
| Boiling Point | 279.9ºC at 760mmHg |
| Melting Point | 56-59ºC |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| HTC | 2932999099 |
| PubChem ID | 3157913 |
| SMILES | O=C(Cl)C1COc2ccccc2O1 |
| InChI | InChI=1S/C9H7ClO3/c10-9(11)8-5-12-6-3-1-2-4-7(6)13-8/h1-4,8H,5H2 |
| InChI Key | UPCGTFBXZKCPOT-UHFFFAOYSA-N |
| MSDS | msds/169976_2_3663_81_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| DL-lysine hydrochloride | 22834-80-6 | 2A-1169840 |
| Tiagabine hydrochloride | 145821-59-6 | 2A-0202294 |
| OXAMIC ACID SODIUM SALT | 565-73-1 | 2A-1169843 |
| 2-METHOXYSTYRENE | 612-15-7 | 2A-1169844 |
| Bitter Melon Extract | 2A-1169846 | 2A-1169846 |
| BIS(PHENYLSULFONYL)SULFIDE | 4388-22-1 | 2A-1169848 |
| 1-PHENYLDECANE | 104-72-3 | 2A-1169849 |
| 4-BROMOBUTYRONITRILE | 5332-06-9 | 2A-1169850 |
| N-BUTYL METHYL ETHER | 628-28-4 | 2A-1169851 |
| 3-OCTANOL | 20296-29-1 | 2A-1169853 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA