
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 261762-63-4 |
| Catalog No. | 2A-1169777 |
| Chinese Name | 2'-氯-6'-氟-3'-甲基苯乙酮 |
| Synonyms | 1-(2-Chloro-6-fluoro-3-methylphenyl)ethanone; GR CF F1 BV1; 1-acetyl-2-chloro-6-fluoro-3-methylbenzene; MFCD01631368 |
| Molecular Formula | C9H8ClFO |
| Molecular Weight | 186.611 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 219.8±35.0 °C at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2914700090 |
| PubChem ID | 3209004 |
| SMILES | CC(=O)c1c(F)ccc(C)c1Cl |
| InChI | InChI=1S/C9H8ClFO/c1-5-3-4-7(11)8(6(2)12)9(5)10/h3-4H,1-2H3 |
| InChI Key | DNESTVGNBQZBHP-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 0,0-Dimethyl Thiophosphate | 1112-38-5 | 2A-1169770 |
| Sephin 1 | 951441-04-6 | 2A-1169772 |
| Mcl1-IN-2 | 292057-76-2 | 2A-1169773 |
| N106 | 862974-25-2 | 2A-1169774 |
| Lazertinib | 1903008-80-9 | 2A-1169775 |
| 1-(5-BROMO-2-FLUOROPHENYL)ETHANONE | 198447-89-3 | 2A-1169778 |
| tert-Butyl 2-bromo-4-fluorobenzoate | 889858-12-2 | 2A-1169779 |
| 1-(2-FLUORO-6-(TRIFLOROMETHYL)BENZYL)UREA | 830346-46-8 | 2A-1169780 |
| 2-Fluoro-3-iodoanisole | 1080673-30-8 | 2A-1169781 |
| (+/-)-PROPANOLOL HCL | 3506-09-0 | 2A-3169783 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA