
CAS Number951441-04-6
SynonymsSephin 1; Ifb-088; N''-[(E)-(2-Chlorophenyl)methylene]carbonohydrazonic diamide; (E)-2-(2-chlorobenzylidene)hydrazinecarboximidamide; Sephin1; MFCD00790608
Molecular FormulaC8H9ClN4
Molecular Weight196.637
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point374.2±44.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 951441-04-6 |
| Catalog No. | 2A-1169772 |
| Chinese Name | Sephin 1 |
| Synonyms | Sephin 1; Ifb-088; N''-[(E)-(2-Chlorophenyl)methylene]carbonohydrazonic diamide; (E)-2-(2-chlorobenzylidene)hydrazinecarboximidamide; Sephin1; MFCD00790608 |
| Molecular Formula | C8H9ClN4 |
| Molecular Weight | 196.637 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 374.2±44.0 °C at 760 mmHg |
| Storage Condition | -20°C, protected from light |
| Application | Sephin 1(NSC 65390) is a selective inhibitor of PPP1R15A that disrupts the PPP1R15A-PP1c complex but not the related PPP1R15B-PP1c complex; prolongs eIF2α phosphorylation after stress, attenuates the |
| PubChem ID | 110760 |
| SMILES | NC(N)=NN=Cc1ccccc1Cl |
| InChI | InChI=1S/C8H9ClN4/c9-7-4-2-1-3-6(7)5-12-13-8(10)11/h1-5H,(H4,10,11,13)/b12-5+ |
| InChI Key | PDWJALXSRRSUHR-LFYBBSHMSA-N |
| Transport Info | Product name: Sephin-1 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| undecanamide | 2244-06-6 | 2A-1169766 |
| VE 822 | 1232416-25-9 | 2A-1169767 |
| 2-N-PROPYL-2(E)-PENTENOICACID | 33786-47-9 | 2A-1169768 |
| 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-, monohydrochloride, [4S-(4alpha,4aalpha,5alpha,5aalpha,6beta,12aalpha)]- | 41411-66-9 | 2A-1169769 |
| 0,0-Dimethyl Thiophosphate | 1112-38-5 | 2A-1169770 |
| Mcl1-IN-2 | 292057-76-2 | 2A-1169773 |
| N106 | 862974-25-2 | 2A-1169774 |
| Lazertinib | 1903008-80-9 | 2A-1169775 |
| 2'-CHLORO-6'-FLUORO-3'-METHYLACETOPHENONE | 261762-63-4 | 2A-1169777 |
| 1-(5-BROMO-2-FLUOROPHENYL)ETHANONE | 198447-89-3 | 2A-1169778 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA