
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 38250-16-7 |
| Catalog No. | 2A-1169693 |
| Chinese Name | 2-(4-羟苯基)-2-氧代乙酸甲酯 |
| Synonyms | Methyl 2-(4-hydroxyphenyl)-2-oxoacetate |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.15700 |
| Purity | 98 |
| Boiling Point | 329.4°C at 760 mmHg |
| Storage Condition | Room temperature, store in inert gas |
| HTC | 2918990090 |
| PubChem ID | 9471815 |
| SMILES | COC(=O)C(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H8O4/c1-13-9(12)8(11)6-2-4-7(10)5-3-6/h2-5,10H,1H3 |
| InChI Key | ACOFACMTVIGUGM-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-isobutylbenzene-1,4-diol | 4197-78-8 | 2A-1169679 |
| 1-Bromo-3-chloro-4-(methylthio)benzene | 101084-82-6 | 2A-1169680 |
| Bis(benzyloxycarbonyl)amine | 69032-13-9 | 2A-1169681 |
| 2,6-dichloro-N-Methyl pyriMidin-4-aMine | 10397-15-6 | 2A-1169690 |
| Phenol, 5-(aminomethyl)-2-chloro- | 943816-63-5 | 2A-1169692 |
| Pentanedioic acid, 3,3-dicyano-, 1,5-diethyl ester | 77415-69-1 | 2A-1169694 |
| Benzamide, 4-amino-3-hydroxy- (9CI) | 146224-62-6 | 2A-1169696 |
| 4-hydroxy-.alpha.,.alpha.-dimethyl-Benzeneacetic acid | 29913-51-7 | 2A-1169697 |
| 2-ethoxy-2-methylpropanamide | 1628184-71-3 | 2A-1169698 |
| N-(2,5-dibromo-4-methoxyphenyl)acetamide | 129319-11-5 | 2A-1169700 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA