
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 943816-63-5 |
| Catalog No. | 2A-1169692 |
| Chinese Name | 5-(氨基甲基)-2-氯苯酚 |
| Synonyms | 4-chloro-3-hydroxybenzylamine; phenol,5-(aminomethyl)-2-chloro |
| Molecular Formula | C7H8ClNO |
| Molecular Weight | 157.59800 |
| Purity | 98 |
| Storage Condition | room temperature |
| HTC | 2922299090 |
| PubChem ID | 92318104 |
| SMILES | NCc1ccc(Cl)c(O)c1 |
| InChI | InChI=1S/C7H8ClNO/c8-6-2-1-5(4-9)3-7(6)10/h1-3,10H,4,9H2 |
| InChI Key | WNCRPZJAKKZECV-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| methyl 4-sulphamoylbenzoate | 22808-73-7 | 2A-1169678 |
| 2-isobutylbenzene-1,4-diol | 4197-78-8 | 2A-1169679 |
| 1-Bromo-3-chloro-4-(methylthio)benzene | 101084-82-6 | 2A-1169680 |
| Bis(benzyloxycarbonyl)amine | 69032-13-9 | 2A-1169681 |
| 2,6-dichloro-N-Methyl pyriMidin-4-aMine | 10397-15-6 | 2A-1169690 |
| 4-Hydroxyphenyloxoacetic acid methyl ester | 38250-16-7 | 2A-1169693 |
| Pentanedioic acid, 3,3-dicyano-, 1,5-diethyl ester | 77415-69-1 | 2A-1169694 |
| Benzamide, 4-amino-3-hydroxy- (9CI) | 146224-62-6 | 2A-1169696 |
| 4-hydroxy-.alpha.,.alpha.-dimethyl-Benzeneacetic acid | 29913-51-7 | 2A-1169697 |
| 2-ethoxy-2-methylpropanamide | 1628184-71-3 | 2A-1169698 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA