
CAS Number158627-59-9
Synonyms4-aminobenzene-1,2-diol,hydrobromide; 1,2-Benzenediol, 4-amino-, hydrobromide (1:1); 4-Amino-1,2-benzenediol hydrobromide (1:1); 3,4-Dihydroxyaniline Hydrobromide
Molecular FormulaC6H8BrNO2
Molecular Weight206.037
Purity97%
Boiling Point363.8ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 158627-59-9 |
| Catalog No. | 2A-1169588 |
| Chinese Name | 3,4-二羟基苯胺氢溴酸盐 |
| Synonyms | 4-aminobenzene-1,2-diol,hydrobromide; 1,2-Benzenediol, 4-amino-, hydrobromide (1:1); 4-Amino-1,2-benzenediol hydrobromide (1:1); 3,4-Dihydroxyaniline Hydrobromide |
| Molecular Formula | C6H8BrNO2 |
| Molecular Weight | 206.037 |
| Purity | 97 |
| Boiling Point | 363.8ºC at 760mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2922299090 |
| PubChem ID | 86452474 |
| SMILES | Br.Nc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C6H7NO2.BrH/c7-4-1-2-5(8)6(9)3-4;/h1-3,8-9H,7H2;1H |
| InChI Key | CMAHPMGEFWJMCI-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(2-amino-benzoyl)-N'-4-Butoxy-benzoylhydrazine | 871100-06-0 | 2A-1169581 |
| METHYL 4-N-BUTOXYBENZOATE | 4906-25-6 | 2A-1169582 |
| ethyl 3-(dibenzylaMino)-2,2-difluoropropanoate | 541547-36-8 | 2A-1169583 |
| 2,5-Diaminophenol | 636-25-9 | 2A-1169585 |
| 3,4-bis(benzyloxy)phenyl formate | 189082-97-1 | 2A-1169586 |
| 4-[(4-cyanophenyl)disulfanyl]benzonitrile | 6339-51-1 | 2A-1169589 |
| 3-(2-hydroxyethoxy)propiononitrile | 24298-26-8 | 2A-1169591 |
| TRANS-2-CHLORO-3 4-DIMETHOXY-B-NITROSTY& | 41122-35-4 | 2A-1169593 |
| 1-(3,4-bis(benzyloxy)phenoxy)-3-(3,4-dimethoxyphenethylamino)propan-2-ol | 782436-39-9 | 2A-1169594 |
| Acetamide, 2,2'-oxybis[N,N-dibutyl- | 82846-38-6 | 2A-1169595 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA