
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4906-25-6 |
| Catalog No. | 2A-1169582 |
| Chinese Name | 4-正丁氧苯甲酸甲酯 |
| Synonyms | Methyl 4-n-butoxybenzoate; methyl 4-butoxybenzoate; MFCD00070801 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.25400 |
| Purity | 98 |
| Density | 1.036 g/cm3 |
| Boiling Point | 188-190ºC 30mm |
| Storage Condition | Store at room temperature, away from light, in a c |
| HTC | 2918990090 |
| PubChem ID | 6197050 |
| SMILES | CCCCOc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C12H16O3/c1-3-4-9-15-11-7-5-10(6-8-11)12(13)14-2/h5-8H,3-4,9H2,1-2H3 |
| InChI Key | PUHCYTHGLBCWEA-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-phenyldodecane | 2719-62-2 | 2A-1169574 |
| N-methyl-2-nitro-5-phenylpyridin-3-amine | 152684-14-5 | 2A-1169575 |
| 3-phenyldodecane | 2400-00-2 | 2A-1169577 |
| 2-broMo-5-hydroxybenzoic acid Methyl ester | 154607-00-8 | 2A-1169579 |
| N-(2-amino-benzoyl)-N'-4-Butoxy-benzoylhydrazine | 871100-06-0 | 2A-1169581 |
| ethyl 3-(dibenzylaMino)-2,2-difluoropropanoate | 541547-36-8 | 2A-1169583 |
| 2,5-Diaminophenol | 636-25-9 | 2A-1169585 |
| 3,4-bis(benzyloxy)phenyl formate | 189082-97-1 | 2A-1169586 |
| 4-Aminocatechol hydrobromide | 158627-59-9 | 2A-1169588 |
| 4-[(4-cyanophenyl)disulfanyl]benzonitrile | 6339-51-1 | 2A-1169589 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA