
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 56092-82-1 |
| Catalog No. | 2A-1169458 |
| Chinese Name | 罗红霉素钙盐 |
| Synonyms | Ionomycin calcium salt; MFCD00151183 |
| Molecular Formula | C41H70CaO9 |
| Molecular Weight | 747.067 |
| Purity | 98 |
| Boiling Point | 817.2ºC at 760mmHg |
| Melting Point | 205-206ºC |
| Appearance | White to light yellow solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Application | Ionomycin (calcium) is a Calcium ionophore and an antibiotic derived from Streptomyces conglobatus. |
| PubChem ID | 11970117 |
| SMILES | CC(CCC(=O)[O-])CC(C)CC(C)C(=O)C=C([O-])C(C)CC(C)CC=CC(C)C(O)C(C)C(O)CC1CCC(C)(C2CCC(C)(C(C)O)O2)O1.[Ca+2] |
| InChI | InChI=1S/C41H71O9.Ca/c1-25(21-29(5)34(43)24-35(44)30(6)22-27(3)20-26(2)14-15-38(46)47)12-11-13-28(4)39(48)31(7)36(45)23-33-16-18-41(10,49-33)37-17-19-40(9,50-37)32(8)42;/h11,13,24-33,36-37,39,42,45,48H,12,14-23H2,1-10H3,(H,46,47);/q-1;+2/p-1/b13-11+;/t25-,26-,27+,28-,29-,30+,31+,32-,33+,36+,37-,39-,40+,41+;/m1./s1 |
| InChI Key | WKRWUYKLUMMAKG-WYGBAUISSA-L |
| Transport Info | Product name: Ionomycin calcium salt |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| DER 736 RESIN | 9072-62-2 | 2A-1169452 |
| EST | 88321-09-9 | 2A-1169454 |
| FIBRONECTIN | 86088-83-7 | 2A-1169455 |
| Glucose oxidase | 9001-37-0 | 2A-1169456 |
| Glycid ether 100 | 90529-77-4 | 2A-1169457 |
| Kerosene, low odor | 8008-20-6 | 2A-1169460 |
| Lactose | 10039-26-6 | 2A-1169461 |
| Maltotriose | 1109-28-0 | 2A-1169464 |
| Nonenylsuccinic anhydride | 28928-97-4 | 2A-1169466 |
| Carbon | 7440-44-0 | 2A-1169467 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA