
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1374639-75-4 |
| Catalog No. | 2A-1168289 |
| Chinese Name | LEE011 琥珀酸盐 |
| Synonyms | MFCD28167746; LEE011-BBA; Ribociclib succinate; UNII:BG7HLX2919; LEE011 (succinate); LEE011 succinate; Ribociclib |
| Molecular Formula | C27H36N8O5 |
| Molecular Weight | 552.625 |
| Storage Condition | Room temperature, store in inert gas |
| Application | Ribociclib succinate (LEE011 succinate) is a highly specific CDK4/6 inhibitor with IC50 values of 10 nM and 39 nM, respectively, and is less than 1000-fold active against the cyclin B/CDK1 complex. |
| PubChem ID | 136336631 |
| SMILES | CN(C)C(=O)c1cc2cnc(Nc3ccc(N4CCNCC4)cn3)nc2n1C1CCCC1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C23H30N8O.C4H6O4/c1-29(2)22(32)19-13-16-14-26-23(28-21(16)31(19)17-5-3-4-6-17)27-20-8-7-18(15-25-20)30-11-9-24-10-12-30;5-3(6)1-2-4(7)8/h7-8,13-15,17,24H,3-6,9-12H2,1-2H3,(H,25,26,27,28);1-2H2,(H,5,6)(H,7,8) |
| InChI Key | NHANOMFABJQAAH-UHFFFAOYSA-N |
| Transport Info | Product name: LEE011 succinate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Amino-5-Methoxythiophenol | 6274-29-9 | 2A-1168269 |
| Diethyl 4-fluorobenzylphosphonate | 63909-58-0 | 2A-1168273 |
| 2-(dimethylamino)benzoic acid chloride | 64109-38-2 | 2A-1168275 |
| 2,6-difluoro-3,5-dimethoxyaniline | 651734-54-2 | 2A-1168276 |
| 9-Bromo-3-(2-Bromo Acetyl)-10,11-Dihydro-5H-dibenzo(c,g) Chromen-8(9H)-one | 1438383-89-1 | 2A-1168282 |
| SPI-115 | 56742-45-1 | 2A-1168294 |
| 1,2,4-TRIAZIN-5(4H)-ONE, 4-AMINO-6-(1,1-DIMETHYLETHYL)-3-METHOXY | 50917-20-9 | 2A-1168295 |
| 10-Hydroxycamptothecin | 64439-81-2 | 2A-1168296 |
| Hydrotalcite | 12304-65-3 | 2A-4168298 |
| FG-4592 | 808118-40-3 | 2A-1168300 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA