
CAS Number5424-50-0
Synonyms3-Dimethylamino-1-phenylpropanol hydrochloride; 3-Dimethylamino-1-phenyl-propan-1-ol,Hydrochlorid; N,N-dimethyl 3-phenyl-3-hydroxypropylamine hydrochloride; N,N-dimethyl-3-phenyl-3-hydroxy-propanamine hydrochloride
Molecular FormulaC11H18ClNO
Molecular Weight215.72000
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5424-50-0 |
| Catalog No. | 2A-1168204 |
| Chinese Name | Benzenemethanol, a-[2-(dimethylamino)ethyl]-,hydrochloride (1:1) |
| Synonyms | 3-Dimethylamino-1-phenylpropanol hydrochloride; 3-Dimethylamino-1-phenyl-propan-1-ol,Hydrochlorid; N,N-dimethyl 3-phenyl-3-hydroxypropylamine hydrochloride; N,N-dimethyl-3-phenyl-3-hydroxy-propanamine hydrochloride |
| Molecular Formula | C11H18ClNO |
| Molecular Weight | 215.72000 |
| HTC | 2922199090 |
| PubChem ID | 540278 |
| SMILES | CN(C)CCC(O)c1ccccc1.Cl |
| InChI | InChI=1S/C11H17NO.ClH/c1-12(2)9-8-11(13)10-6-4-3-5-7-10;/h3-7,11,13H,8-9H2,1-2H3;1H |
| InChI Key | NADQJAUBGUEARA-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2H-3,1-Benzoxazine-2,4(1H)-dione, 6-methoxy-1-methyl- | 52851-64-6 | 2A-1168197 |
| 2,2-DIFLUORO-1,3-BENZODIOXOLE-4-ACETIC ACID | 531508-33-5 | 2A-1168199 |
| 4-pentylbenzene-1,3-diol | 533-24-4 | 2A-1168200 |
| 2,2-diethoxyethanethiol | 53608-94-9 | 2A-1168201 |
| Methyl 3-(2-methoxyphenyl)-3-oxopropanoate | 54177-02-5 | 2A-1168203 |
| 4-ISOPROPYLCYCLOHEXANONE | 5432-85-9 | 2A-1168205 |
| 1,3-bis(1-phenylvinyl)benzene | 54378-43-7 | 2A-1168208 |
| 2-cyano-3-(3,4-dimethoxyphenyl)propanoic acid | 55502-61-9 | 2A-1168211 |
| 1-hydroxycyclobutane-1-carbonitrile | 55767-58-3 | 2A-1168212 |
| Potassium (pyridin-2-yl)trifluoroborate | 561328-70-9 | 2A-1168213 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA