CAS Number54177-02-5
SynonymsMethyl 3-(2-methoxyphenyl)-3-oxopropanoate; methyl 2-methoxybenzoylacetate; Benzenepropanoic acid, 2-methoxy-β-oxo-, methyl ester; o-methoxybenzoylacetic acid methyl ester; 2-Methoxy-benzoylessigsaeuremethylester
Molecular FormulaC11H12O4
Molecular Weight208.211
Density1.1±0.1 g/cm3
Boiling Point291.7±15.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54177-02-5 |
| Catalog No. | 2A-1168203 |
| Chinese Name | 3-(2-甲氧基苯基)-3-氧丙酸甲酯 |
| Synonyms | Methyl 3-(2-methoxyphenyl)-3-oxopropanoate; methyl 2-methoxybenzoylacetate; Benzenepropanoic acid, 2-methoxy-β-oxo-, methyl ester; o-methoxybenzoylacetic acid methyl ester; 2-Methoxy-benzoylessigsaeuremethylester |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.211 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 291.7±15.0 °C at 760 mmHg |
| Storage Condition | Room temperature, inert gas storage |
| HTC | 2918990090 |
| PubChem ID | 3187187 |
| SMILES | COC(=O)CC(=O)c1ccccc1OC |
| InChI | InChI=1S/C11H12O4/c1-14-10-6-4-3-5-8(10)9(12)7-11(13)15-2/h3-6H,7H2,1-2H3 |
| InChI Key | OEIWRCBBMGTEMA-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4,10-DIOXATRICYCLO[5.2.1.0(2,6)]DEC-8-ENE-3,5-DIONE | 5246-09-5 | 2A-1168196 |
| 2H-3,1-Benzoxazine-2,4(1H)-dione, 6-methoxy-1-methyl- | 52851-64-6 | 2A-1168197 |
| 2,2-DIFLUORO-1,3-BENZODIOXOLE-4-ACETIC ACID | 531508-33-5 | 2A-1168199 |
| 4-pentylbenzene-1,3-diol | 533-24-4 | 2A-1168200 |
| 2,2-diethoxyethanethiol | 53608-94-9 | 2A-1168201 |
| 3-(Dimethylamino)-1-phenylpropan-1-olhydrochloride | 5424-50-0 | 2A-1168204 |
| 4-ISOPROPYLCYCLOHEXANONE | 5432-85-9 | 2A-1168205 |
| 1,3-bis(1-phenylvinyl)benzene | 54378-43-7 | 2A-1168208 |
| 2-cyano-3-(3,4-dimethoxyphenyl)propanoic acid | 55502-61-9 | 2A-1168211 |
| 1-hydroxycyclobutane-1-carbonitrile | 55767-58-3 | 2A-1168212 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS