
CAS Number23876-12-2
SynonymsBenzaldehyde,2-methyl-3-nitro; 3-formyl-2-methyl-1-nitrobenzene; 2-Methyl-3-nitro-benzaldehyd; 2-Methyl-3-nitrobenzaldehyde; 3-nitro-2-methylbenzaldehyde
Molecular FormulaC8H7NO3
Molecular Weight165.146
Density1.3±0.1 g/cm3
Boiling Point274.6±28.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 23876-12-2 |
| Catalog No. | 2A-1168050 |
| Chinese Name | 2-甲基-3-硝基苯甲醛 |
| Synonyms | Benzaldehyde,2-methyl-3-nitro; 3-formyl-2-methyl-1-nitrobenzene; 2-Methyl-3-nitro-benzaldehyd; 2-Methyl-3-nitrobenzaldehyde; 3-nitro-2-methylbenzaldehyde |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.146 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 274.6±28.0 °C at 760 mmHg |
| Storage Condition | Room temperature, sealed, dry, inert gas |
| HTC | 2913000090 |
| PubChem ID | 400387 |
| SMILES | Cc1c(C=O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7NO3/c1-6-7(5-10)3-2-4-8(6)9(11)12/h2-5H,1H3 |
| InChI Key | ATLCWADLCUCTLL-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-dichlorophosphoryl-N-propan-2-ylpropan-2-amine | 23306-80-1 | 2A-1168045 |
| DICHLORAMINE B | 473-29-0 | 2A-1168046 |
| 2-amino-5-fluoro-acetophenone | 2343-25-1 | 2A-1168046 |
| N,N'-Ditosylcystamine | 23516-74-7 | 2A-1168047 |
| 2-(4-(2-hydroxyethyl)phenyl)-2-Methylpropanoic acid | 552301-45-8 | 2A-1168048 |
| 4,6-dichloro-N,N-dimethyl-1,3,5-triazin-2-amine | 2401-64-1 | 2A-1168052 |
| 2,4,6-Trichlorothiophenol | 24207-66-7 | 2A-1168053 |
| 2-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine | 24650-10-0 | 2A-1168055 |
| 3-METHYLAZETIDIN-3-OL | 256931-54-1 | 2A-1168056 |
| 2-[4-(Methylsulfamoyl)Phenyl]Acetic Acid | 261524-34-9 | 2A-1168057 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA