
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2343-25-1 |
| Catalog No. | 2A-1168046 |
| Chinese Name | 2-氨基-5-氟苯乙酮 |
| Synonyms | 1-(2-Amino-5-fluorophenyl)ethanone |
| Molecular Formula | C8H8FNO |
| Molecular Weight | 153.154 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 264.2±20.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, protected from light, stored in inert gas |
| HTC | 2922399090 |
| PubChem ID | 37235291 |
| SMILES | CC(=O)c1cc(F)ccc1N |
| InChI | InChI=1S/C8H8FNO/c1-5(11)7-4-6(9)2-3-8(7)10/h2-4H,10H2,1H3 |
| InChI Key | JCBLTXXNEXJVFT-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(4-Sulfamoylphenyl)acetic acid | 22958-64-1 | 2A-1168042 |
| ethyl 2,2,2-trichloroethanimidate | 23213-96-9 | 2A-1168043 |
| 2,3-diaminobutanedioic acid | 23220-52-2 | 2A-1168044 |
| N-dichlorophosphoryl-N-propan-2-ylpropan-2-amine | 23306-80-1 | 2A-1168045 |
| DICHLORAMINE B | 473-29-0 | 2A-1168046 |
| N,N'-Ditosylcystamine | 23516-74-7 | 2A-1168047 |
| 2-(4-(2-hydroxyethyl)phenyl)-2-Methylpropanoic acid | 552301-45-8 | 2A-1168048 |
| 3-Formyl-2-methyl-1-nitrobenzene | 23876-12-2 | 2A-1168050 |
| 4,6-dichloro-N,N-dimethyl-1,3,5-triazin-2-amine | 2401-64-1 | 2A-1168052 |
| 2,4,6-Trichlorothiophenol | 24207-66-7 | 2A-1168053 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA