
CAS Number2050-94-4
SynonymsDiamyl carbonate; Dipentylcarbonat; di(pentyl)carbonate; Kohlensaeure-dipentylester; Carbonic acid, dipentyl ester; Dipentyl carbonate; bis(n-pentyl)carbonate; Carbonic acid,dipentyl ester; Di-n-pentylcarbonat
Molecular FormulaC11H22O3
Molecular Weight202.291
Density0.9±0.1 g/cm3
Boiling Point247.2±9.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2050-94-4 |
| Catalog No. | 2A-1168022 |
| Chinese Name | 碳酸二戊酯 |
| Synonyms | Diamyl carbonate; Dipentylcarbonat; di(pentyl)carbonate; Kohlensaeure-dipentylester; Carbonic acid, dipentyl ester; Dipentyl carbonate; bis(n-pentyl)carbonate; Carbonic acid,dipentyl ester; Di-n-pentylcarbonat |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.291 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 247.2±9.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2920909090 |
| PubChem ID | 73704 |
| SMILES | CCCCCOC(=O)OCCCCC |
| InChI | InChI=1S/C11H22O3/c1-3-5-7-9-13-11(12)14-10-8-6-4-2/h3-10H2,1-2H3 |
| InChI Key | HSNQKJVQUFYBBY-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| phenyl guanidine | 2002-16-6 | 2A-1168012 |
| 1-bromoprop-1-yne | 2003-82-9 | 2A-1168013 |
| Cetirizine Amide Dihydrochloride | 200707-85-3 | 2A-1168014 |
| 2-chloro-1-(3-chloro-4-fluorophenyl)ethanone | 203251-37-0 | 2A-1168016 |
| D-PLUS-MELEZITOSE HYDRATE | 207511-10-2 | 2A-1168021 |
| 2-Methyl-2-(4-methyl-3-pentenyl)-7-pentyl-2H-1-benzopyran-5-ol | 20675-51-8 | 2A-1168024 |
| 1-bromo-8-chloro-naphthalene | 20816-79-9 | 2A-1168025 |
| 4-(N,N-dimethylcarbamimidoyl)benzoic acid | 210963-78-3 | 2A-1168027 |
| 4-chloro-3-methoxy-5-nitro- Benzamide | 2137975-62-1 | 2A-1168032 |
| 2-(3-Nitrophenyl)propanoic acid | 21762-10-7 | 2A-1168035 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA