
CAS Number2002-16-6
Synonymsphenyl guanidine; N-Guanyl-anilin; N-Phenylguanidine; GUANIDINE,PHENYL; F2158-0402; 1-Phenylguanidine; EINECS 217-898-7; Phenyl-guanidin
Molecular FormulaC7H9N3
Molecular Weight135.16600
Density1.17g/cm3
Boiling Point290.5ºC at 760mmHg
AppearanceWhite to yellow solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2002-16-6 |
| Catalog No. | 2A-1168012 |
| Chinese Name | 苯基胍 |
| Synonyms | phenyl guanidine; N-Guanyl-anilin; N-Phenylguanidine; GUANIDINE,PHENYL; F2158-0402; 1-Phenylguanidine; EINECS 217-898-7; Phenyl-guanidin |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.16600 |
| Density | 1.17g/cm3 |
| Boiling Point | 290.5ºC at 760mmHg |
| Appearance | White to yellow solid |
| Storage Condition | Room temperature, dry, protected from light |
| HTC | 2925290090 |
| PubChem ID | 5271242 |
| SMILES | NC(N)=Nc1ccccc1 |
| InChI | InChI=1S/C7H9N3.ClH/c8-7(9)10-6-4-2-1-3-5-6;/h1-5H,(H4,8,9,10);1H |
| InChI Key | QRJZGVVKGFIGLI-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2925290090 other imines and their derivatives; salts thereof. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2- (8-BROMO-2, 3-DIHYDRO-1, 4-BENZODIOXIN-5-YL) ETHAN-1-OL | 1897489-56-3 | 2A-1168002 |
| 2-(3-BROMO-4-CYCLOHEXYLPHENYL) ETHAN-1-OL | 1898038-55-5 | 2A-1168003 |
| 1-(isoindolin-5-yl-)ethan-1-one hydrochloride | 1909348-59-9 | 2A-1168004 |
| 1-hydroxy-4-(phenylamino)anthracene-9,10-dione | 19286-75-0 | 2A-1168005 |
| 1-(5-CHLORO[1,1'-BIPHENYL]-2-YL)-2,2,2-TRIFLUOROETHANONE | 1998068-09-9 | 2A-1168011 |
| 1-bromoprop-1-yne | 2003-82-9 | 2A-1168013 |
| Cetirizine Amide Dihydrochloride | 200707-85-3 | 2A-1168014 |
| 2-chloro-1-(3-chloro-4-fluorophenyl)ethanone | 203251-37-0 | 2A-1168016 |
| D-PLUS-MELEZITOSE HYDRATE | 207511-10-2 | 2A-1168021 |
| Dipentyl carbonate | 2050-94-4 | 2A-1168022 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA