
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7168-99-2 |
| Catalog No. | 2A-1167597 |
| Chinese Name | AKOS 233-46 |
| Synonyms | 1,3-Benzenedicarboxylic acid,4,6-dimethoxy; 4,6-dimethoxy-isophthalic acid; 4,6-Dimethoxy-isophthalsaeure |
| Molecular Formula | C10H10O6 |
| Molecular Weight | 226.18300 |
| HTC | 2918990090 |
| PubChem ID | 28677614 |
| SMILES | COc1cc(OC)c(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C10H10O6/c1-15-7-4-8(16-2)6(10(13)14)3-5(7)9(11)12/h3-4H,1-2H3,(H,11,12)(H,13,14) |
| InChI Key | SSKJKUWEVZTCMC-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-bromo-2-methylbutyl acetate | 2A-1167591 | 2A-1167591 |
| Pivalimidamide Hydrochloride | 18202-73-8 | 2A-1167592 |
| 2-(phenylmethylidene)indene-1,3-dione | 5381-33-9 | 2A-1167594 |
| Benzoic acid, 2-(2-hydroxy-1-oxo-3-phenyl-2-propen-1-yl) | 43053-07-2 | 2A-1167595 |
| N-(2-(2-Methoxyphenoxy)ethyl)benzylamine hydrochloride | 3246-05-3 | 2A-1167596 |
| 2-(2-(chloromethoxy)ethoxy) propane | 1540576-88-2 | 2A-1167600 |
| 4-Formyl-2-hydroxybenzoic acid; 4-Formylsalicylic acid | 51572-88-4 | 2A-1167601 |
| 3,3,3-trifluoropropane-1,2-diamine. 2HCl | 2A-1167602 | 2A-1167602 |
| zinc bromate | 14519-07-4 | 2A-1167564 |
| 2-bromo-2-chloroacetonitrile | 83463-62-1 | 2A-1167608 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA