
CAS Number223673-61-8
SynonymsMyrbetriq; N-(4-(2-(2-hydroxy-2-phenylethylamino)ethyl)phenyl)-2-(2-aminothiazol-4-yl)acetamide; YM-178; MIRABEQRON; 2-Amino-N-[4-[2-[[(2R)-2-hydroxy-2-phenyl-ethyl]amino]-ethyl]phenyl]-4-thiazoleacetamide; 2-(2-Amino-1,3-thiazol-4-yl)-N-[4-(2-{[(2R)-2-hydroxy-2-phenylethyl]amino}ethyl)phenyl]acetamide; Betanis; Betmiga; Mirabegron; 2-(2-amino-1,3-thiazol-4-yl)-N-(4-{2-[(2-hydroxy-2-phenylethyl)amino]ethyl}phenyl)acetamide
Molecular FormulaC21H24N4O2S
Molecular Weight396.506
Density1.3±0.1 g/cm3
Boiling Point690.0±55.0 °C at 760 mmHg
Melting Point138-140°C
AppearanceLight yellow or yellow solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 223673-61-8 |
| Catalog No. | 2A-1167448 |
| Chinese Name | 米拉贝隆 |
| Synonyms | Myrbetriq; N-(4-(2-(2-hydroxy-2-phenylethylamino)ethyl)phenyl)-2-(2-aminothiazol-4-yl)acetamide; YM-178; MIRABEQRON; 2-Amino-N-[4-[2-[[(2R)-2-hydroxy-2-phenyl-ethyl]amino]-ethyl]phenyl]-4-thiazoleacetamide; 2-(2-Amino-1,3-thiazol-4-yl)-N-[4-(2-{[(2R)-2-hydroxy-2-phenylethyl]amino}ethyl)phenyl]acetamide; Betanis; Betmiga; Mirabegron; 2-(2-amino-1,3-thiazol-4-yl)-N-(4-{2-[(2-hydroxy-2-phenylethyl)amino]ethyl}phenyl)acetamide |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.506 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 690.0±55.0 °C at 760 mmHg |
| Melting Point | 138-140°C |
| Appearance | Light yellow or yellow solid |
| Storage Condition | Store in a cool, dry, airtight container. |
| Application | Mirabegron is a selective adrenoceptor (β3-adrenoceptor) agonist with an EC50 of 22.4 nM. |
| PubChem ID | 14830284 |
| SMILES | Nc1nc(CC(=O)Nc2ccc(CCNCC(O)c3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C21H24N4O2S/c22-21-25-18(14-28-21)12-20(27)24-17-8-6-15(7-9-17)10-11-23-13-19(26)16-4-2-1-3-5-16/h1-9,14,19,23,26H,10-13H2,(H2,22,25)(H,24,27)/t19-/m0/s1 |
| InChI Key | PBAPPPCECJKMCM-IBGZPJMESA-N |
| Transport Info | Product name: Mirabegron |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| methyl 5-methyl-3-oxohexanoate | 30414-55-2 | 2A-1167442 |
| (E)-4-(4-methoxyphenyl)but-3-en-2-one | 3815-30-3 | 2A-1167443 |
| Prilocaine | 751-50-6 | 2A-1167444 |
| 2-(benzyloxy)-5-chlorophenol | 1189360-82-4 | 2A-1167445 |
| 3-((4-methylphenyl)sulfonamido)propanoic acid | 42908-33-8 | 2A-1167446 |
| (Z)-octadec-9-en-1-yl 4-methylbenzenesulfonate | 2A-1167449 | 2A-1167449 |
| benzyl (3-(4-fluorophenyl)-2-oxopropyl)carbamate | 2A-1167450 | 2A-1167450 |
| 4-azidobutanoic acid | 54447-68-6 | 2A-1167452 |
| 7-isopropoxy-3,4-dihydronaphthalen-1(2H)-one | 117666-68-9 | 2A-1167453 |
| 2-amino-n-ethylbutanamide.hydrochloride | 187680-43-9 | 2A-1167454 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA