
CAS Number30414-55-2
SynonymsMethyl 5-methyl-3-oxohexanoate; 5-Methyl-3-oxo-hexanoic acid methyl ester; Hexanoic acid, 5-methyl-3-oxo-, methyl ester; Methyl α-isovalerylacetate
Molecular FormulaC8H14O3
Molecular Weight158.195
Density1.0±0.1 g/cm3
Boiling Point199.4±8.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 30414-55-2 |
| Catalog No. | 2A-1167442 |
| Chinese Name | 5-甲基-3-羰基己酸甲酯 |
| Synonyms | Methyl 5-methyl-3-oxohexanoate; 5-Methyl-3-oxo-hexanoic acid methyl ester; Hexanoic acid, 5-methyl-3-oxo-, methyl ester; Methyl α-isovalerylacetate |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.195 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 199.4±8.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, store in inert gas |
| HTC | 2918300090 |
| PubChem ID | 10239763 |
| SMILES | COC(=O)CC(=O)CC(C)C |
| InChI | InChI=1S/C8H14O3/c1-6(2)4-7(9)5-8(10)11-3/h6H,4-5H2,1-3H3 |
| InChI Key | WUGKTJAKSVEAFG-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| pyrazolidine-3,5-dione | 4744-71-2 | 2A-0201953 |
| 1-(4-bromophenyl)cyclopropane-1-carboxylic hypobromous anhydride | 2A-1167437 | 2A-1167437 |
| 3-(o-tolyl)propan-1-ol | 14902-36-4 | 2A-1167438 |
| 1-(4-methoxyphenyl)azetidin-2-one | 7661-29-2 | 2A-1167439 |
| CERIUM OXIDE | 23322-64-7 | 2A-1167441 |
| (E)-4-(4-methoxyphenyl)but-3-en-2-one | 3815-30-3 | 2A-1167443 |
| Prilocaine | 751-50-6 | 2A-1167444 |
| 2-(benzyloxy)-5-chlorophenol | 1189360-82-4 | 2A-1167445 |
| 3-((4-methylphenyl)sulfonamido)propanoic acid | 42908-33-8 | 2A-1167446 |
| Mirabegron | 223673-61-8 | 2A-1167448 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA