CAS Number50298-90-3
Synonyms25-deacetyl hemslecin A; 22,23-dihydrocucurbitacin F; 23,24-Dihydrocucurbitacin F; dihydrocucurbitacin F; CucurbitacinⅡb; Cucurbitacin Ⅱb
Molecular FormulaC30H48O7
Molecular Weight520.698
Density1.22±0.1 g/cm3
Boiling Point668.4±55.0 °C at 760 mmHg
Melting Point158-159ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 50298-90-3 |
| Catalog No. | 2A-1166986 |
| Chinese Name | 葫芦素 IIB； 雪胆素乙 |
| Synonyms | 25-deacetyl hemslecin A; 22,23-dihydrocucurbitacin F; 23,24-Dihydrocucurbitacin F; dihydrocucurbitacin F; CucurbitacinⅡb; Cucurbitacin Ⅱb |
| Molecular Formula | C30H48O7 |
| Molecular Weight | 520.698 |
| Density | 1.22±0.1 g/cm3 |
| Boiling Point | 668.4±55.0 °C at 760 mmHg |
| Melting Point | 158-159ºC |
| Storage Condition | 2-8°C |
| Application | Cucurbitacin IIb is the active ingredient in snow bile, induces apoptosis and has anti-inflammatory activity. Cucurbitacin IIb inhibits the phosphorylation of STAT3, JNK and Erk1/2, enhances the phosp |
| PubChem ID | 15505698 |
| SMILES | CC(C)(O)CCC(=O)C(C)(O)C1C(O)CC2(C)C3CC=C4C(CC(O)C(O)C4(C)C)C3(C)C(=O)CC12C |
| InChI | InChI=1S/C30H48O7/c1-25(2,36)12-11-21(33)30(8,37)23-19(32)14-27(5)20-10-9-16-17(13-18(31)24(35)26(16,3)4)29(20,7)22(34)15-28(23,27)6/h9,17-20,23-24,31-32,35-37H,10-15H2,1-8H3/t17-,18+,19-,20+,23?,24-,27+,28-,29+,30+/m1/s1 |
| InChI Key | VVBWBGOEAVGFTN-LPQIEKFGSA-N |
| Transport Info | Product Name: Snow Cholin B |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dehydrotrametenolic acid | 29220-16-4 | 2A-1166981 |
| Thonningianin A | 271579-11-4 | 2A-1166982 |
| Thonningianin B | 271579-12-5 | 2A-1166983 |
| Curcurbitacin Iia | 129357-90-0 | 2A-1166984 |
| Hemslecin A | 58546-34-2 | 2A-1166985 |
| melarsoprol | 494-79-1 | 2A-1166988 |
| Fexinidazole | 59729-37-2 | 2A-1166989 |
| 4-cyclopropylnaphthalen-1-amine hydrochloride | 1533519-92-4 | 2A-1166992 |
| 5,6,7,8-tetrahydronaphthalene-1,6,7-triol | 344764-57-4 | 2A-1166994 |
| 2-bromo-6-chloro-Benzenamine | 59772-49-5 | 2A-1167000 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS