
CAS Number58546-34-2
Synonyms23,24-Dihydrocucurbitacin F-25-O-acetate; Curcurbitacin Q1; Dihydrocucurbitacin F 25-O-acetate; X1160; Dihydrocucurbitacin Q1; 25-O-Acetyl-23,24-dihydrocucurbitacin F; Cucurbitacin IIa; Hemslecin A
Molecular FormulaC32H50O8
Molecular Weight562.735
Density1.2±0.1 g/cm3
Boiling Point679.1±55.0 °C at 760 mmHg
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 58546-34-2 |
| Catalog No. | 2A-1166985 |
| Chinese Name | 雪胆甲素 |
| Synonyms | 23,24-Dihydrocucurbitacin F-25-O-acetate; Curcurbitacin Q1; Dihydrocucurbitacin F 25-O-acetate; X1160; Dihydrocucurbitacin Q1; 25-O-Acetyl-23,24-dihydrocucurbitacin F; Cucurbitacin IIa; Hemslecin A |
| Molecular Formula | C32H50O8 |
| Molecular Weight | 562.735 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 679.1±55.0 °C at 760 mmHg |
| Appearance | powder |
| Storage Condition | -20℃ |
| Application | Cucurbitacin IIa is a triterpene isolated from the orchard fruit gallbladder, which can induce apoptosis in cancer cells. Cucurbitacin IIa reduces the expression of survivin, decreases the levels of p |
| PubChem ID | 10259388 |
| SMILES | CC(=O)OC(C)(C)CCC(=O)C(C)(O)C1C(O)CC2(C)C3CC=C4C(CC(O)C(O)C4(C)C)C3(C)C(=O)CC12C |
| InChI | InChI=1S/C32H50O8/c1-17(33)40-27(2,3)13-12-23(36)32(9,39)25-21(35)15-29(6)22-11-10-18-19(14-20(34)26(38)28(18,4)5)31(22,8)24(37)16-30(25,29)7/h10,19-22,25-26,34-35,38-39H,11-16H2,1-9H3/t19-,20+,21-,22+,25+,26-,29+,30-,31+,32+/m1/s1 |
| InChI Key | LKYNAQSYQLFTCM-GYXNDICUSA-N |
| Transport Info | Product name: Snow bile A |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cyclocephaloside II | 215776-78-6 | 2A-1166978 |
| Dehydrotrametenolic acid | 29220-16-4 | 2A-1166981 |
| Thonningianin A | 271579-11-4 | 2A-1166982 |
| Thonningianin B | 271579-12-5 | 2A-1166983 |
| Curcurbitacin Iia | 129357-90-0 | 2A-1166984 |
| CucurbitacinⅡb | 50298-90-3 | 2A-1166986 |
| melarsoprol | 494-79-1 | 2A-1166988 |
| Fexinidazole | 59729-37-2 | 2A-1166989 |
| 4-cyclopropylnaphthalen-1-amine hydrochloride | 1533519-92-4 | 2A-1166992 |
| 5,6,7,8-tetrahydronaphthalene-1,6,7-triol | 344764-57-4 | 2A-1166994 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA