
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6257-03-0 |
| Catalog No. | 2A-9001618 |
| Chinese Name | 2,3,5,6-四氟硝基苯 |
| Synonyms | MFCD02093333; 1,2,4,5-Tetrafluoro-3-nitrobenzene |
| Molecular Formula | C6HF4NO2 |
| Molecular Weight | 195.071 |
| Purity | 98 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 223.6±35.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2904909090 |
| SMILES | O=[N+]([O-])c1c(F)c(F)cc(F)c1F |
| InChI Key | YLNJZWIHZRLYRI-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,3,5,6-Tetrafluoro-4-hydroxybenzoic acid | 652-34-6 | 2A-9001612 |
| 2,3,5,6-Tetrafluoroaniline | 700-17-4 | 2A-9001613 |
| 2,3,5,6-Tetrafluorobenzoic acid | 652-18-6 | 2A-9001615 |
| 2,3,5,6-Tetrafluorobenzonitrile | 5216-17-1 | 2A-9001616 |
| 2,3,5,6-Tetrafluorobenzyl alcohol | 4084-38-2 | 2A-9001617 |
| 2,3,5,6-Tetrafluorophenol | 769-39-1 | 2A-9001619 |
| 2,3,5-Trifluoroaniline | 363-80-4 | 2A-9001626 |
| 2,3,5-Trifluorobenzoic acid | 654-87-5 | 2A-9001628 |
| 2,3,5-Trifluorobenzonitrile | 241154-09-6 | 2A-9001629 |
| 2,3,5-Triiodobenzoic acid | 88-82-4 | 2A-9001631 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA