
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5216-17-1 |
| Catalog No. | 2A-9001616 |
| Chinese Name | 2,3,5,6-四氟苯腈 |
| Synonyms | 2,3,5,6-tetrafluorobenzenecarbonitrile; 4H-Perfluorobenzonitrile; MFCD00012286 |
| Molecular Formula | C7HF4N |
| Molecular Weight | 175.08300 |
| Purity | 98 |
| Density | 1.231g/cm3 |
| Boiling Point | 88-90 °C45 mm Hg(lit.) |
| Melting Point | 33-36 °C(lit.) |
| Storage Condition | Keep away from light, cool and dry place, sealed a |
| Packaging | III |
| HTC | 2926909090 |
| UN(IATA) | UN 1325 |
| SMILES | N#Cc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C7HF4N/c8-4-1-5(9)7(11)3(2-12)6(4)10/h1H |
| InChI Key | IOQMWOBRUDNEOA-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| Risk Codes | R20/21/22 |
| Safety Description | S26;S36/37/39 |
| MSDS | msds/1616_1_5216_17_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 99.5% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,3,5,6-Tetrachloroterephthalic acid dimethyl ester | 1861-32-1 | 2A-9001610 |
| 2,3,5,6-Tetrachloroterephthaloyl dichloride | 719-32-4 | 2A-9001611 |
| 2,3,5,6-Tetrafluoro-4-hydroxybenzoic acid | 652-34-6 | 2A-9001612 |
| 2,3,5,6-Tetrafluoroaniline | 700-17-4 | 2A-9001613 |
| 2,3,5,6-Tetrafluorobenzoic acid | 652-18-6 | 2A-9001615 |
| 2,3,5,6-Tetrafluorobenzyl alcohol | 4084-38-2 | 2A-9001617 |
| 2,3,5,6-Tetrafluoronitrobenzene | 6257-03-0 | 2A-9001618 |
| 2,3,5,6-Tetrafluorophenol | 769-39-1 | 2A-9001619 |
| 2,3,5-Trifluoroaniline | 363-80-4 | 2A-9001626 |
| 2,3,5-Trifluorobenzoic acid | 654-87-5 | 2A-9001628 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA