
CAS Number87-90-1
SynonymsMFCD00006553; symclosene; EINECS 201-782-8; Trichloroisocyanuric Acid
Molecular FormulaC3Cl3N3O3
Molecular Weight232.41
Purity97%
Density2.2±0.1 g/cm3
Boiling Point272.3±23.0 °C at 760 mmHg
Melting Point225-230 °C (decomposition)
Appearancecrystals
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 87-90-1 |
| Catalog No. | 2A-9016010 |
| Chinese Name | 三氯异氰脲酸 |
| Synonyms | MFCD00006553; symclosene; EINECS 201-782-8; Trichloroisocyanuric Acid |
| Molecular Formula | C3Cl3N3O3 |
| Molecular Weight | 232.41 |
| Purity | 97 |
| Density | 2.2±0.1 g/cm3 |
| Boiling Point | 272.3±23.0 °C at 760 mmHg |
| Melting Point | 225-230 °C (decomposition) |
| Appearance | crystals |
| Water Solubility | 1.2 g/100mL (25 ºC) |
| Storage Condition | 1. This product should be sealed with argon gas an |
| Packaging | II |
| HTC | 2933692200 |
| MDL Number | MFCD00006553 |
| SMILES | Cl[n]1[c]([n]([c]([n]([c]1=O)Cl)=O)Cl)=O |
| InChI | 1S/C3Cl3N3O3/c4-7-1(10)8(5)3(12)9(6)2(7)11 |
| InChI Key | YRIZYWQGELRKNT-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352115 |
| Hazard Symbols | 5.1 |
| MSDS | msds/16010_1_87_90_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | M.Inspection of imported goods N.Inspection of exported goods |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Tributylphosphine | 998-40-3 | 2A-0201772 |
| Trichloroacetic acid | 76-03-9 | 2A-9016006 |
| Trichloroacetonitrile | 545-06-2 | 2A-9016007 |
| Trichloroacetyl chloride | 76-02-8 | 2A-9016008 |
| Trichloroethylene | 79-01-6 | 2A-9016009 |
| Tricresyl phosphate | 1330-78-5 | 2A-9016013 |
| ORTHOACETIC ACID TRIETHYL ESTER | 78-39-7 | 2A-9016015 |
| Triethyl Orthoformate | 122-51-0 | 2A-9016016 |
| Triethyl orthopropionate | 115-80-0 | 2A-9016017 |
| Triethyl phosphate | 78-40-0 | 2A-9016018 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA