| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1261504-50-0 |
| Catalog No. | 2A-0157781 |
| Chinese Name | 2-羟基-6-硝基苯甲酸甲酯 |
| Synonyms | Methyl 2-hydroxy-6-nitrobenzoate; Benzoic acid, 2-hydroxy-6-nitro-, methyl ester |
| Molecular Formula | C8H7NO5 |
| Molecular Weight | 197.145 |
| Purity | 96+ |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 289.6±25.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| EINECS | 0 |
| HTC | 2918290000 |
| UN(IATA) | 0 |
| PubChem ID | 176236100 |
| MDL Number | MFCD28976547 |
| SMILES | COC(=O)c1c(O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7NO5/c1-14-8(11)7-5(9(12)13)3-2-4-6(7)10/h2-4,10H,1H3 |
| InChI Key | VGRACNKLIBCDHG-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| METHYL 2-FLUORO-6-METHYLBENZOATE | 197516-57-7 | 2A-0157751 |
| METHYL 2-HYDROXY-3-METHOXY-3,3-DIPHENYLPROPANOATE | 178306-47-3 | 2A-0157762 |
| METHYL 2-HYDROXY-3-PHENYLPROPANOATE | 13674-16-3 | 2A-0157766 |
| METHYL 2-HYDROXY-5-NITROBENZOATE | 17302-46-4 | 2A-0157779 |
| METHYL 2-HYDROXY-6-METHYLBENZOATE | 33528-09-5 | 2A-0157780 |
| METHYL 2-HYDROXYDOCOSANOATE | 13980-17-1 | 2A-0157783 |
| METHYL 2-HYDROXYHEXADECANOATE | 16742-51-1 | 2A-0157784 |
| METHYL 2-HYDROXYICOSANOATE | 16742-49-7 | 2A-0157785 |
| METHYL 2-IODO-4,5-DIMETHOXYBENZOATE | 173043-61-3 | 2A-0157789 |
| METHYL 2-IODO-5-NITROBENZOATE | 112239-00-6 | 2A-0157790 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS