CAS Number13674-16-3
SynonymsMethyl (2R)-2-hydroxy-3-phenylpropanoate; Benzenepropanoic acid, α-hydroxy-, methyl ester; (S)-2-Hydroxy-3-phenylpropionic acid, methyl ester; Methyl-(2R)-2-hydroxy-3-phenylpropanoate; 2-Hydroxy-3-phenyl-propionic acid m; ethyl ester; Methyl L-3-phenyllactate; Methyl2-hydroxy-3-phenylpropanoate; 2-HYDROXY-3-PHENYL-PROPIONIC ACID METHYL ESTER; (S)-Methyl 2-hydroxy-3-phenylpropanoate; Methyl 2-hydroxy-3-phenylpropanoate; methyl (2S)-2-hydroxy-3-phenylpropanoate
Molecular FormulaC10H12O3
Molecular Weight180.2
Purity96+%
Density1.1±0.1 g/cm3
Boiling Point286.1±20.0 °C at 760 mmHg
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13674-16-3 |
| Catalog No. | 2A-0157766 |
| Chinese Name | 甲基2-羟基-3-苯丙酸酯 |
| Synonyms | Methyl (2R)-2-hydroxy-3-phenylpropanoate; Benzenepropanoic acid, α-hydroxy-, methyl ester; (S)-2-Hydroxy-3-phenylpropionic acid, methyl ester; Methyl-(2R)-2-hydroxy-3-phenylpropanoate; 2-Hydroxy-3-phenyl-propionic acid m; ethyl ester; Methyl L-3-phenyllactate; Methyl2-hydroxy-3-phenylpropanoate; 2-HYDROXY-3-PHENYL-PROPIONIC ACID METHYL ESTER; (S)-Methyl 2-hydroxy-3-phenylpropanoate; Methyl 2-hydroxy-3-phenylpropanoate; methyl (2S)-2-hydroxy-3-phenylpropanoate |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.2 |
| Purity | 96+ |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 286.1±20.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| EINECS | 0 |
| HTC | 2918199090 |
| UN(IATA) | 0 |
| PubChem ID | 3248953 |
| SMILES | COC(=O)C(O)Cc1ccccc1 |
| InChI | InChI=1S/C10H12O3/c1-13-10(12)9(11)7-8-5-3-2-4-6-8/h2-6,9,11H,7H2,1H3 |
| InChI Key | NMPPJJIBQQCOOI-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| METHYL 2-FLUORO-5-HYDROXYBENZOATE | 1084801-91-1 | 2A-0157746 |
| METHYL 2-FLUORO-5-METHYLBENZOATE | 2967-93-3 | 2A-0157747 |
| METHYL 2-FLUORO-6-HYDROXYBENZOATE | 72373-81-0 | 2A-1157749 |
| METHYL 2-FLUORO-6-METHYLBENZOATE | 197516-57-7 | 2A-0157751 |
| METHYL 2-HYDROXY-3-METHOXY-3,3-DIPHENYLPROPANOATE | 178306-47-3 | 2A-0157762 |
| METHYL 2-HYDROXY-5-NITROBENZOATE | 17302-46-4 | 2A-0157779 |
| METHYL 2-HYDROXY-6-METHYLBENZOATE | 33528-09-5 | 2A-0157780 |
| METHYL 2-HYDROXY-6-NITROBENZOATE | 1261504-50-0 | 2A-0157781 |
| METHYL 2-HYDROXYDOCOSANOATE | 13980-17-1 | 2A-0157783 |
| METHYL 2-HYDROXYHEXADECANOATE | 16742-51-1 | 2A-0157784 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS