CAS Number4079-64-5
SynonymsH-Asp(OBzl)-OBzl inverted exclamation mark currencyTosOH; (D)-H-Asp-(OBn)-OBn*p-TsOH; MFCD00035102; (2R)-1,4-Bis(benzyloxy)-1,4-dioxo-2-butanaminium 4-methylbenzenesulfonate; (D)-Asp-(OBn)2*p-TsOH; h-d-asp(obzl)-obzl ptsa; D-Aspartic acid dibenzyl ester-p-toluenesulfonate; d-aspartic acid dibenzyl ester p-toluenesulfonate; d-aspartic acid dibenzyl ester tosylate; d-aspdb tsoh; h-d-asp(obzl)-obzl tos; D-aspartate dibenzylester p-toluenesulfonate; (R)-aspartic acid dibenzylester p-toluenesulfonate; D-Asp(OBn)-OBn*p-TsOH salt; D-Aspartic acid, bis(phenylmethyl) ester, 4-methylbenzenesulfonate (1:1); Dibenzyl D-aspartate 4-methylbenzenesulfonate (1:1); (R)-Dibenzyl 2-aminosuccinate 4-methylbenzenesulfonate; dibenzyl L-aspartate*p-TsOH; H-D-Asp(OBzl)-OBzl.TosOH; D-aspartic acid dibenzyl ester t
Molecular FormulaC25H27NO7S
Molecular Weight485.549
Purity96+%
Boiling Point455.3ºC at 760 mmHg
Melting Point155-158 °C
AppearanceWhite to yellow solid
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4079-64-5 |
| Catalog No. | 2A-0156007 |
| Chinese Name | D-天门冬氨酸苄酯对甲苯磺酸盐 |
| Synonyms | H-Asp(OBzl)-OBzl inverted exclamation mark currencyTosOH; (D)-H-Asp-(OBn)-OBn*p-TsOH; MFCD00035102; (2R)-1,4-Bis(benzyloxy)-1,4-dioxo-2-butanaminium 4-methylbenzenesulfonate; (D)-Asp-(OBn)2*p-TsOH; h-d-asp(obzl)-obzl ptsa; D-Aspartic acid dibenzyl ester-p-toluenesulfonate; d-aspartic acid dibenzyl ester p-toluenesulfonate; d-aspartic acid dibenzyl ester tosylate; d-aspdb tsoh; h-d-asp(obzl)-obzl tos; D-aspartate dibenzylester p-toluenesulfonate; (R)-aspartic acid dibenzylester p-toluenesulfonate; D-Asp(OBn)-OBn*p-TsOH salt; D-Aspartic acid, bis(phenylmethyl) ester, 4-methylbenzenesulfonate (1:1); Dibenzyl D-aspartate 4-methylbenzenesulfonate (1:1); (R)-Dibenzyl 2-aminosuccinate 4-methylbenzenesulfonate; dibenzyl L-aspartate*p-TsOH; H-D-Asp(OBzl)-OBzl.TosOH; D-aspartic acid dibenzyl ester t |
| Molecular Formula | C25H27NO7S |
| Molecular Weight | 485.549 |
| Purity | 96+ |
| Boiling Point | 455.3ºC at 760 mmHg |
| Melting Point | 155-158 °C |
| Appearance | White to yellow solid |
| Storage Condition | Store at RT. |
| EINECS | 0 |
| HTC | 2923900090 |
| UN(IATA) | 0 |
| PubChem ID | 57296817 |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.NC(CC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H19NO4.C7H8O3S/c19-16(18(21)23-13-15-9-5-2-6-10-15)11-17(20)22-12-14-7-3-1-4-8-14;1-6-2-4-7(5-3-6)11(8,9)10/h1-10,16H,11-13,19H2;2-5H,1H3,(H,8,9,10)/t16-;/m1./s1 |
| InChI Key | HLMUYZYLPUHSNV-PKLMIRHRSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product Name: Summary 2923900090 other quaternary ammonium salts and hydroxides. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| H-D-ALA-ALA-ALA-OH | 5874-89-5 | 2A-0155997 |
| H-D-ALA-D-ALA-D-ALA-OH | 1114-94-9 | 2A-0155998 |
| H-D-ALA-GLY-GLY-OH | 77286-90-9 | 2A-0155999 |
| H-D-ARG(NO2)-OME HCL | 50912-92-0 | 2A-0156003 |
| H-D-ARG-OME.2HCL | 78851-84-0 | 2A-0156006 |
| H-D-ASP(OTBU)-OTBU HCL | 135904-71-1 | 2A-0156010 |
| H-D-CYS(TRT)-OH | 25840-82-8 | 2A-0156012 |
| H-D-GLU(OBZL)-OBZL.TOS | 19898-41-0 | 2A-0156013 |
| H-D-GLU(OBZL)-OH | 2578-33-8 | 2A-0156014 |
| H-D-GLU(OME)-OH | 6461-04-7 | 2A-0156015 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS