
CAS Number25635-17-0
Synonyms2-Methyl-pyridin-carbonsaeure-(4)-ethylester; 2-methyl-isonicotinic acid ethyl ester; 2-methyl 4-ethoxycarbonyl pyridine; 2-Methyl-isonicotinsaeure-aethylester; 4-Pyridinecarboxylic acid, 2-methyl-, ethyl ester; Ethyl 2-methylisonicotinate; 2-Methyl-isonicotinsaeure-ethylester; 2-Methylpyridine-4-carboxylic acid ethyl ester; 4-Ethoxycarbonyl-2-methyl-pyridin
Molecular FormulaC9H11NO2
Molecular Weight165.19
Purity96+%
Density1.1±0.1 g/cm3
Boiling Point240.3±20.0 °C at 760 mmHg
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 25635-17-0 |
| Catalog No. | 2A-0153797 |
| Chinese Name | 2-甲基吡啶-4-羧酸乙酯 |
| Synonyms | 2-Methyl-pyridin-carbonsaeure-(4)-ethylester; 2-methyl-isonicotinic acid ethyl ester; 2-methyl 4-ethoxycarbonyl pyridine; 2-Methyl-isonicotinsaeure-aethylester; 4-Pyridinecarboxylic acid, 2-methyl-, ethyl ester; Ethyl 2-methylisonicotinate; 2-Methyl-isonicotinsaeure-ethylester; 2-Methylpyridine-4-carboxylic acid ethyl ester; 4-Ethoxycarbonyl-2-methyl-pyridin |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 |
| Purity | 96+ |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 240.3±20.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| EINECS | 0 |
| HTC | 2933399090 |
| UN(IATA) | 0 |
| PubChem ID | 38288109 |
| SMILES | CCOC(=O)c1ccnc(C)c1 |
| InChI | InChI=1S/C9H11NO2/c1-3-12-9(11)8-4-5-10-7(2)6-8/h4-6H,3H2,1-2H3 |
| InChI Key | WOMYMRWGDVTGQI-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| ETHYL 2-IODOBENZOATE | 1829-28-3 | 2A-0153759 |
| ETHYL 2-METHOXY-6-NITROBENZOATE | 99060-89-6 | 2A-0153764 |
| ETHYL 2-METHYL-2-(PIPERIDIN-4-YL)PROPANOATE | 243836-26-2 | 2A-0153769 |
| ETHYL 2-METHYL-3,5-DINITROBENZOATE | 854646-60-9 | 2A-0153773 |
| ETHYL 2-METHYL-5-NITROBENZOATE | 124358-24-3 | 2A-0153787 |
| ETHYL 2-METHYLPENT-3-ENOATE | 1617-23-8 | 2A-0153801 |
| ETHYL 2-OXO-2-((2-OXO-2-PHENYLETHYL)AMINO)ACETATE | 84978-66-5 | 2A-0153821 |
| ETHYL 2-OXO-2-(2-OXOTETRAHYDRO-2H-PYRAN-3-YL)ACETATE | 61202-99-1 | 2A-0153823 |
| ETHYL 2-OXO-2-(4-OXOTETRAHYDRO-2H-PYRAN-3-YL)ACETATE | 857177-01-6 | 2A-0153825 |
| ETHYL 2-OXO-2-(THIAZOL-2-YL)ACETATE | 33656-63-2 | 2A-0153826 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA