CAS Number1829-28-3
Synonyms2-iodobenzoic acid ethyl ester; ethyl 2-iodanylbenzoate; ethyl o-iodobenzoate; Benzoic acid, 2-iodo-, ethyl ester; MFCD00051796; ethyl iodobenzoate; EINECS MFCD00051796; Ethyl 2-iodobenzoate
Molecular FormulaC9H9IO2
Molecular Weight276.07
Purity96+%
Density1.7±0.1 g/cm3
Boiling Point275.6±13.0 °C at 760 mmHg
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1829-28-3 |
| Catalog No. | 2A-0153759 |
| Chinese Name | 2-碘苯甲酸乙酯 |
| Synonyms | 2-iodobenzoic acid ethyl ester; ethyl 2-iodanylbenzoate; ethyl o-iodobenzoate; Benzoic acid, 2-iodo-, ethyl ester; MFCD00051796; ethyl iodobenzoate; EINECS MFCD00051796; Ethyl 2-iodobenzoate |
| Molecular Formula | C9H9IO2 |
| Molecular Weight | 276.07 |
| Purity | 96+ |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 275.6±13.0 °C at 760 mmHg |
| Water Solubility | Difficult to mix. |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| EINECS | 0 |
| HTC | 2916399090 |
| UN(IATA) | 0 |
| PubChem ID | 3294634 |
| SMILES | CCOC(=O)c1ccccc1I |
| InChI | InChI=1S/C9H9IO2/c1-2-12-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
| InChI Key | QOUFDDUDXYJWHV-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| ETHYL 2-FLUORO-5-METHYLBENZOATE | 496841-90-8 | 2A-0153740 |
| ETHYL 2-HYDRAZINYL-2-OXOACETATE | 35196-48-6 | 2A-0153749 |
| ETHYL 2-HYDROXY-5-IODOBENZOATE | 15125-84-5 | 2A-0153753 |
| ETHYL 2-HYDROXY-5-NITRONICOTINATE | 156896-54-7 | 2A-0153754 |
| ETHYL 2-HYDROXY-6-NITROBENZOATE | 1261477-56-8 | 2A-0153756 |
| ETHYL 2-METHOXY-6-NITROBENZOATE | 99060-89-6 | 2A-0153764 |
| ETHYL 2-METHYL-2-(PIPERIDIN-4-YL)PROPANOATE | 243836-26-2 | 2A-0153769 |
| ETHYL 2-METHYL-3,5-DINITROBENZOATE | 854646-60-9 | 2A-0153773 |
| ETHYL 2-METHYL-5-NITROBENZOATE | 124358-24-3 | 2A-0153787 |
| ETHYL 2-METHYLISONICOTINATE | 25635-17-0 | 2A-0153797 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS