
CAS Number1888-87-5
Synonymsisobutyldichloroalane; Isobutylaluminiumdichlorid; IBADC; dichloroisobutylaluminum; EINECS 217-563-5; dichloro(isobutyl)alumane; dichloroisobutylaluminium; MFCD00013583; dichloro(2-methylpropyl)alumane; isobutylaluminium dichloride; Isobutyldichloroaluminum; i-butylaluminum dichloride; dichloro(2-methylpropyl)-aluminu
Molecular FormulaC4H9AlCl2
Molecular Weight155.00200
Purity98.00%
Density1.12 g/mL at 25ºC(lit.)
Boiling Point242ºC(lit.)
Melting Point-30ºC(lit.)
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1888-87-5 |
| Catalog No. | 2A-9014674 |
| Chinese Name | 二氯异丁基铝 |
| Synonyms | isobutyldichloroalane; Isobutylaluminiumdichlorid; IBADC; dichloroisobutylaluminum; EINECS 217-563-5; dichloro(isobutyl)alumane; dichloroisobutylaluminium; MFCD00013583; dichloro(2-methylpropyl)alumane; isobutylaluminium dichloride; Isobutyldichloroaluminum; i-butylaluminum dichloride; dichloro(2-methylpropyl)-aluminu |
| Molecular Formula | C4H9AlCl2 |
| Molecular Weight | 155.00200 |
| Purity | 98.00 |
| Density | 1.12 g/mL at 25ºC(lit.) |
| Boiling Point | 242ºC(lit.) |
| Melting Point | -30ºC(lit.) |
| Storage Condition | Seal and store in a cool place away from light |
| HTC | 2903199000 |
| SMILES | CC(C)C[Al](Cl)Cl |
| InChI | InChI=1S/C4H9.Al.2ClH/c1-4(2)3;;;/h4H,1H2,2-3H3;;2*1H/q;+2;;/p-2 |
| InChI Key | NMVXHZSPDTXJSJ-UHFFFAOYSA-L |
| Hazard Symbols | 4.2 |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2903199000 other saturated chlorinated derivatives of acyclic hydrocarbons. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Isobutyl chloride | 513-36-0 | 2A-9014668 |
| Isobutyl iodide | 513-38-2 | 2A-9014669 |
| Isobutyl isobutyrate | 97-85-8 | 2A-9014670 |
| Isobutyl methacrylate | 97-86-9 | 2A-9014671 |
| isobutyl nitrile | 542-56-3 | 2A-9014672 |
| Isobutyric acid | 79-31-2 | 2A-9014676 |
| Isobutyric acid potassium salt | 19455-20-0 | 2A-9014677 |
| Isobutyronitrile | 78-82-0 | 2A-9014678 |
| Isobutyryl chloride | 79-30-1 | 2A-9014679 |
| Isooctyl Alcohol | 26952-21-6 | 2A-9014680 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA