
CAS Number97-85-8
SynonymsIsobutyric acid, isobutyl ester; EINECS 202-612-5; 2-Methylpropyl isobutyrate; Isobutyl 2-methylpropanoate; MFCD00008916; Isobutyl isobutanoate; Propanoic acid, 2-methyl-, 2-methylpropyl ester; 2-methylpropyl 2-methylpropanoate; Isobutyl isobutyrate
Molecular Formula(CH3)2CHCO2CH2CH(CH3)2
Molecular Weight144.21
Purity≥98%
Density0.9±0.1 g/cm3
Boiling Point145-152 °C (lit.)
Melting Point−81 °C (lit.)
Appearancecolorless liquid
EINECS202-612-5
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 97-85-8 |
| Catalog No. | 2A-9014670 |
| Chinese Name | 异丁酸异丁酯 |
| Synonyms | Isobutyric acid, isobutyl ester; EINECS 202-612-5; 2-Methylpropyl isobutyrate; Isobutyl 2-methylpropanoate; MFCD00008916; Isobutyl isobutanoate; Propanoic acid, 2-methyl-, 2-methylpropyl ester; 2-methylpropyl 2-methylpropanoate; Isobutyl isobutyrate |
| Molecular Formula | (CH3)2CHCO2CH2CH(CH3)2 |
| Molecular Weight | 144.21 |
| Purity | ≥98 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 145-152 °C (lit.) |
| Melting Point | −81 °C (lit.) |
| Appearance | colorless liquid |
| Storage Condition | Storage precautions: Store in a cool, ventilated w |
| Packaging | III |
| EINECS | 202-612-5 |
| HTC | 2915600000 |
| PubChem ID | 24878238 |
| MDL Number | MFCD00008916 |
| SMILES | CC(C)COC(=O)C(C)C |
| InChI | 1S/C8H16O2/c1-6(2)5-10-8(9)7(3)4/h6-7H,5H2,1-4H3 |
| InChI Key | RXGUIWHIADMCFC-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1701355 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 3 |
| MSDS | msds/14670_1_97_85_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Isobutyl 4-hydroxybenzoate | 4247-02-3 | 2A-9014665 |
| Isobutyl acetate | 110-19-0 | 2A-9014666 |
| Isobutyl acetoacetate | 7779-75-1 | 2A-9014667 |
| Isobutyl chloride | 513-36-0 | 2A-9014668 |
| Isobutyl iodide | 513-38-2 | 2A-9014669 |
| Isobutyl methacrylate | 97-86-9 | 2A-9014671 |
| isobutyl nitrile | 542-56-3 | 2A-9014672 |
| Isobutylaluminum dichloride | 1888-87-5 | 2A-9014674 |
| Isobutyric acid | 79-31-2 | 2A-9014676 |
| Isobutyric acid potassium salt | 19455-20-0 | 2A-9014677 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA