
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 27682-64-0 |
| Catalog No. | 2A-0144290 |
| Chinese Name | 5-氯-2-乙氧基苯甲醛 |
| Synonyms | 5-Chloro-2-ethoxy-benzaldehyde; benzaldehyde,5-chloro-2-ethoxy |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.62000 |
| Purity | 96+ |
| Density | 1.202g/cm3 |
| Boiling Point | 279.1ºC at 760mmHg |
| EINECS | 0 |
| HTC | 2913000090 |
| UN(IATA) | 0 |
| SMILES | CCOc1ccc(Cl)cc1C=O |
| InChI | InChI=1S/C9H9ClO2/c1-2-12-9-4-3-8(10)5-7(9)6-11/h3-6H,2H2,1H3 |
| InChI Key | JVUJRLHWDLJULI-UHFFFAOYSA-N |
| MSDS | msds/144290_1_27682_64_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 5-CHLORO-2-((4-METHYLBENZYL)OXY)BENZALDEHYDE | 590360-23-9 | 2A-0144242 |
| 5-CHLORO-2-(ISOPENTYLOXY)BENZALDEHYDE | 81995-29-1 | 2A-0144264 |
| 5-CHLORO-2-(TRIFLUOROMETHOXY)BENZALDEHYDE | 1092461-15-8 | 2A-0144277 |
| 5-CHLORO-2-(TRIFLUOROMETHYL)BENZOIC ACID | 654-98-8 | 2A-0144280 |
| 5-CHLORO-2-(TRIFLUOROMETHYL)PHENOL | 106877-35-4 | 2A-0144281 |
| 5-CHLORO-2-HYDROXY-3-NITROBENZALDEHYDE | 16634-90-5 | 2A-0144332 |
| 5-CHLORO-2-HYDROXY-4-METHYLBENZALDEHYDE | 3328-68-5 | 2A-0144336 |
| 5-CHLORO-2-HYDROXYBENZOHYDRAZIDE | 5022-48-0 | 2A-0144341 |
| 5-CHLORO-2-ISOBUTOXYBENZALDEHYDE | 27590-77-8 | 2A-0144359 |
| 5-CHLORO-2-ISOPROPOXYBENZALDEHYDE | 28396-34-1 | 2A-0144360 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA