
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 106877-35-4 |
| Catalog No. | 2A-0144281 |
| Chinese Name | 5-氯-2-(三氟甲基)苯酚 |
| Synonyms | 2-TRIFLUOROMETHYL-5-CHLOROPHENOL; 5-chloro-2-trifluoromethylphenol |
| Molecular Formula | C7H4ClF3O |
| Molecular Weight | 289.54 |
| Purity | ≥99.0 (GC) |
| Melting Point | 55-60 °C |
| Appearance | powder |
| EINECS | 0 |
| HTC | 2908199090 |
| UN(IATA) | 0 |
| MDL Number | MFCD00800992 |
| SMILES | Clc1c(ccc(c1)Cl)Oc2c(cc(cc2)Cl)O |
| InChI | 1S/C12H7Cl3O2/c13-7-1-3-11(9(15)5-7)17-12-4-2-8(14)6-10(12)16/h1-6,16H |
| InChI Key | XEFQLINVKFYRCS-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352104 |
| MSDS | msds/144281_1_106877_35_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 5-CHLORO-2-((4-FLUOROBENZYL)OXY)BENZALDEHYDE | 590360-22-8 | 2A-0144241 |
| 5-CHLORO-2-((4-METHYLBENZYL)OXY)BENZALDEHYDE | 590360-23-9 | 2A-0144242 |
| 5-CHLORO-2-(ISOPENTYLOXY)BENZALDEHYDE | 81995-29-1 | 2A-0144264 |
| 5-CHLORO-2-(TRIFLUOROMETHOXY)BENZALDEHYDE | 1092461-15-8 | 2A-0144277 |
| 5-CHLORO-2-(TRIFLUOROMETHYL)BENZOIC ACID | 654-98-8 | 2A-0144280 |
| 5-CHLORO-2-ETHOXYBENZALDEHYDE | 27682-64-0 | 2A-0144290 |
| 5-CHLORO-2-HYDROXY-3-NITROBENZALDEHYDE | 16634-90-5 | 2A-0144332 |
| 5-CHLORO-2-HYDROXY-4-METHYLBENZALDEHYDE | 3328-68-5 | 2A-0144336 |
| 5-CHLORO-2-HYDROXYBENZOHYDRAZIDE | 5022-48-0 | 2A-0144341 |
| 5-CHLORO-2-ISOBUTOXYBENZALDEHYDE | 27590-77-8 | 2A-0144359 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA