
CAS Number13001-28-0
SynonymsMFCD03265371; 2-(4-CHLOROPHENOXY)ETHYL CHLORIDE; (2-chloro-ethyl)-(4-chloro-phenyl)-ether; 1-chloro-4-(2-chloroethoxy)-benzene; (2-Chlor-aethyl)-(4-chlor-phenyl)-aether; EINECS 235-833-0; 4-chloro-(2-chloroethoxy)-benzene; Benzene,1-chloro-4-(2-chloroethoxy); 4-(2-chloroethoxy)-chlorobenzene
Molecular FormulaC8H8O1Cl2
Molecular Weight191.06
Purity98%
Density1.246 g/cm3
Boiling Point257.8ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13001-28-0 |
| Catalog No. | 2A-9001392 |
| Chinese Name | 2-(4-氯苯氧基)-1-氯乙烷 |
| Synonyms | MFCD03265371; 2-(4-CHLOROPHENOXY)ETHYL CHLORIDE; (2-chloro-ethyl)-(4-chloro-phenyl)-ether; 1-chloro-4-(2-chloroethoxy)-benzene; (2-Chlor-aethyl)-(4-chlor-phenyl)-aether; EINECS 235-833-0; 4-chloro-(2-chloroethoxy)-benzene; Benzene,1-chloro-4-(2-chloroethoxy); 4-(2-chloroethoxy)-chlorobenzene |
| Molecular Formula | C8H8O1Cl2 |
| Molecular Weight | 191.06 |
| Purity | 98 |
| Density | 1.246 g/cm3 |
| Boiling Point | 257.8ºC at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2909309090 |
| MDL Number | MFCD03265371 |
| SMILES | ClCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H8Cl2O/c9-5-6-11-8-3-1-7(10)2-4-8/h1-4H,5-6H2 |
| InChI Key | DFJCCNZMGVNBKQ-UHFFFAOYSA-N |
| MSDS | msds/1392_1_13001_28_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2'-(4-Bromobenzyloxy)acetophenone | 2A-101384 | 2A-9001384 |
| 2-(4-Bromophenyl)-2-methylpropionic acid | 32454-35-6 | 2A-9001385 |
| 2-(4-Chlorophenoxy)-2-methylpropanoic acid ethyl ester | 637-07-0 | 2A-9001388 |
| 2-(4'-Chlorophenoxy)aniline | 2770-11-8 | 2A-9001390 |
| 2-(4-Chlorophenoxy)butane | 2A-101391 | 2A-9001391 |
| 2-(4-Chlorophenyl)thiazoline | 2A-101399 | 2A-9001399 |
| 2-(4-Fluorophenoxy)-1-{6-[1-(4-fluorophenoxy)ethyl]pyridin-3-yl}propan-1-one | 2A-101404 | 2A-9001404 |
| 2-(4-Hydroxybenzoyl)benzoic acid | 85-57-4 | 2A-9001411 |
| 2-(4-Hydroxythiazol-2-yl)acetamide | 87947-94-2 | 2A-9001415 |
| 2-(4-Isopropylphenylthio)benzoic acid | 2A-101416 | 2A-9001416 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA