
CAS Number13244-33-2
Synonymsp-Anisidine-2-sulfonic Acid; MFCD00035804; 2-Amino-5-methoxybenzenesulfonic acid; EINECS 236-224-2; 4-Methoxyaniline-2-sulfonic Acid; 4-Aminoanisole-3-sulfonic Acid
Molecular FormulaC7H9O4N1S1
Molecular Weight203.22
Purity98.00%
Density1.5±0.1 g/cm3
Melting Point314-318ºC
AppearanceOrange to red powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13244-33-2 |
| Catalog No. | 2A-9013477 |
| Chinese Name | 对氨基苯甲醚-3-磺酸 |
| Synonyms | p-Anisidine-2-sulfonic Acid; MFCD00035804; 2-Amino-5-methoxybenzenesulfonic acid; EINECS 236-224-2; 4-Methoxyaniline-2-sulfonic Acid; 4-Aminoanisole-3-sulfonic Acid |
| Molecular Formula | C7H9O4N1S1 |
| Molecular Weight | 203.22 |
| Purity | 98.00 |
| Density | 1.5±0.1 g/cm3 |
| Melting Point | 314-318ºC |
| Appearance | Orange to red powder |
| Storage Condition | Room temperature, dry |
| HTC | 2922299090 |
| MDL Number | MFCD00035804 |
| SMILES | COc1ccc(N)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C7H9NO4S/c1-12-5-2-3-6(8)7(4-5)13(9,10)11/h2-4H,8H2,1H3,(H,9,10,11)/p-1 |
| InChI Key | KZKGEEGADAWJFS-UHFFFAOYSA-N |
| MSDS | msds/13477_1_13244_33_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4,4'-Methylenebis(n-phenylmaleimide) | 13676-54-5 | 2A-1013472 |
| 4-Amino-2-hydroxybenzoic acid sodium salt | 133-10-8 | 2A-9013473 |
| 4-Amino-3,5-dichlorobenzotrifluoride | 24279-39-8 | 2A-9013474 |
| 4-Amino-3-nitrobenzoic acid | 1588-83-6 | 2A-9013475 |
| 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid | 90-20-0 | 2A-9013476 |
| 4-Aminobenzoic acid | 150-13-0 | 2A-9013478 |
| 4-Aminophenetole | 156-43-4 | 2A-9013479 |
| 4-Aminophenol | 123-30-8 | 2A-9013480 |
| 4-Aminophenylacetic acid | 1197-55-3 | 2A-9013481 |
| 4-Benzyloxyaniline hydrochloride | 51388-20-6 | 2A-9013483 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA