CAS Number90-20-0
SynonymsH Acids; kyselina1-amino-8-naftol-3,6-disulfonova; 1-AMINO-8-NAPHTHOL-3,6-DISULFONIC ACID; 1-Amino-8-naphthol-3,6-disulphonicacid; 1-amino-8-hydroxynaphtalene-3,6-disulfonic acid; 4-hydroxy-5-amino-2,7-naphthalenedisulfonic acid; kyselinah; 8-AMINO-1-NAPHTHOL-3,6-DISULFONIC ACID; 1-amino-8-hydroxynaphthalene-3,6-disulfonic acid; MFCD00035728; EINECS 201-975-7; Sulfonphthol; 1-Naphthol-8-amino-3,6-disulfonicacid; kyselina8-amino-1-naftol-3,6-disulfonova; 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid; 1-hydroxy-8-aminonaphthalene-3,6-disulfonic acid; 1-Amino-8-hydroxy-3,6-disulfonaphthalene; 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid
Molecular FormulaC10H9O7N1S2
Molecular Weight319.32
Purity98.00%
Density1.9±0.1 g/cm3
Melting Point>300 °C(lit.)
AppearanceWhite to gray-yellow powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 90-20-0 |
| Catalog No. | 2A-9013476 |
| Chinese Name | H酸 |
| Synonyms | H Acids; kyselina1-amino-8-naftol-3,6-disulfonova; 1-AMINO-8-NAPHTHOL-3,6-DISULFONIC ACID; 1-Amino-8-naphthol-3,6-disulphonicacid; 1-amino-8-hydroxynaphtalene-3,6-disulfonic acid; 4-hydroxy-5-amino-2,7-naphthalenedisulfonic acid; kyselinah; 8-AMINO-1-NAPHTHOL-3,6-DISULFONIC ACID; 1-amino-8-hydroxynaphthalene-3,6-disulfonic acid; MFCD00035728; EINECS 201-975-7; Sulfonphthol; 1-Naphthol-8-amino-3,6-disulfonicacid; kyselina8-amino-1-naftol-3,6-disulfonova; 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid; 1-hydroxy-8-aminonaphthalene-3,6-disulfonic acid; 1-Amino-8-hydroxy-3,6-disulfonaphthalene; 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid |
| Molecular Formula | C10H9O7N1S2 |
| Molecular Weight | 319.32 |
| Purity | 98.00 |
| Density | 1.9±0.1 g/cm3 |
| Melting Point | >300 °C(lit.) |
| Appearance | White to gray-yellow powder |
| Storage Condition | Store sealed and away from light. |
| HTC | 2922299090 |
| MDL Number | MFCD00035728 |
| SMILES | Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(O)c12 |
| InChI | InChI=1S/C10H9NO7S2/c11-8-3-6(19(13,14)15)1-5-2-7(20(16,17)18)4-9(12)10(5)8/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18) |
| InChI Key | APRRQJCCBSJQOQ-UHFFFAOYSA-N |
| MSDS | msds/13476_1_90_20_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4,4'-Dihydroxydiphenyl ether | 1965-09-9 | 2A-9013470 |
| 4,4'-Methylenebis(n-phenylmaleimide) | 13676-54-5 | 2A-1013472 |
| 4-Amino-2-hydroxybenzoic acid sodium salt | 133-10-8 | 2A-9013473 |
| 4-Amino-3,5-dichlorobenzotrifluoride | 24279-39-8 | 2A-9013474 |
| 4-Amino-3-nitrobenzoic acid | 1588-83-6 | 2A-9013475 |
| 4-Aminoanisole-3-sulfonic acid | 13244-33-2 | 2A-9013477 |
| 4-Aminobenzoic acid | 150-13-0 | 2A-9013478 |
| 4-Aminophenetole | 156-43-4 | 2A-9013479 |
| 4-Aminophenol | 123-30-8 | 2A-9013480 |
| 4-Aminophenylacetic acid | 1197-55-3 | 2A-9013481 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS