
CAS Number80937-23-1
Synonyms(E)Ethyl4-(3,4-dimethoxyphenyl; 3-(3,4-dimethoxybenzoyl)acrylic acid; (E)4-(3,4-dimethyoxyphenyl)-4-oxo-2-butenoate; 4-(3,4-dimethoxyphenyl)-4-oxocrotonic acid; 4-(3,4-dimethoxyphenyl)-4-oxo-2-butenoic acid; (E)-4-(3,4-dimethoxyphenyl)-4-oxocrotonic acid ethyl aster; MFCD08458864; (E)-4-(3,4-Dimethoxyphenyl)-4-oxo-2-butenoic acid; Ethyl 4-(3,4-dimethoxyphenyl)-4-oxycrotonate; 4-Oxo-4-(3.4-dimethoxy-phenyl)-trans-crotonsaeure; VAC; (E)Ethyl 4-(3,4-dimethoxyphenyl)-4-oxo-2-butenoate (VAC); (E)ETHYL 4-(3,4-DIMETHOXYPHENYL)-4-OXO-2-BUTENOATE; (E)-ethyl 4-(3,4-dimethoxyphenyl)-4-oxobut-2-enoate; 4-oxo-4-(3.4-dimethoxy-phenyl)-trans-crotonic acid; EINECS 279-631-0
Molecular FormulaC14H16O5
Molecular Weight264.27400
Purity98%
Density1.138g/cm3
Boiling Point393.2ºC at 760 mmHg
Melting Point87.0-91.0ºC
EINECS279-631-0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 80937-23-1 |
| Catalog No. | 2A-9000134 |
| Chinese Name | (E)-4-(3,4-二甲氧基苯基)-4-氧代-2-丁烯酸乙酯 |
| Synonyms | (E)Ethyl4-(3,4-dimethoxyphenyl; 3-(3,4-dimethoxybenzoyl)acrylic acid; (E)4-(3,4-dimethyoxyphenyl)-4-oxo-2-butenoate; 4-(3,4-dimethoxyphenyl)-4-oxocrotonic acid; 4-(3,4-dimethoxyphenyl)-4-oxo-2-butenoic acid; (E)-4-(3,4-dimethoxyphenyl)-4-oxocrotonic acid ethyl aster; MFCD08458864; (E)-4-(3,4-Dimethoxyphenyl)-4-oxo-2-butenoic acid; Ethyl 4-(3,4-dimethoxyphenyl)-4-oxycrotonate; 4-Oxo-4-(3.4-dimethoxy-phenyl)-trans-crotonsaeure; VAC; (E)Ethyl 4-(3,4-dimethoxyphenyl)-4-oxo-2-butenoate (VAC); (E)ETHYL 4-(3,4-DIMETHOXYPHENYL)-4-OXO-2-BUTENOATE; (E)-ethyl 4-(3,4-dimethoxyphenyl)-4-oxobut-2-enoate; 4-oxo-4-(3.4-dimethoxy-phenyl)-trans-crotonic acid; EINECS 279-631-0 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.27400 |
| Purity | 98 |
| Density | 1.138g/cm3 |
| Boiling Point | 393.2ºC at 760 mmHg |
| Melting Point | 87.0-91.0ºC |
| EINECS | 279-631-0 |
| HTC | 2918990090 |
| SMILES | COc1ccc(cc1OC)C(=O)\C=C\C(O)=O |
| InChI | InChI=1S/C12H12O5/c1-16-10-5-3-8(7-11(10)17-2)9(13)4-6-12(14)15/h3-7H,1-2H3,(H,14,15)/b6-4+ |
| InChI Key | InChIKey=QUWWWXPLUJFEHM-GQCTYLIASA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (E)-1-(2-Hydroxy-4,6-dimethoxyphenyl)-3-phenylpropenone | 1775-97-9 | 2A-9000129 |
| (E)-3-(3-Bromo-4-fluorophenyl)acryloyl chloride | 2A-100130 | 2A-9000130 |
| (E)-3-(4-Bromo-2-fluorophenyl)acryloyl chloride | 2A-100131 | 2A-9000131 |
| (E)-3-(4-Hydroxy-3-methoxyphenyl)acrylic acid octacosyl ester | 2A-100132 | 2A-9000132 |
| (E)-3-(Dimethylamino)-1-(2-methyl-1,6-naphthyridin-3-yl)prop-2-en-1-one | 2A-100133 | 2A-9000133 |
| (E)-Hept-2-enoyl chloride | 2A-100135 | 2A-9000135 |
| (E)-Hex-2-enoyl chloride | 2A-100136 | 2A-9000136 |
| (E)-Methyl 3-(4-hydroxyphenyl)acrylate | 830-09-1 | 2A-9000137 |
| (E)-N-Ethyl-N-[2-(4-methoxyphenoxy)ethyl]-4-[(4-nitrophenyl)diazenyl]benzenamine | 2A-100138 | 2A-9000138 |
| (E/Z)-1-Bromo-2-fluoroethylene | 460-11-7 | 2A-9000139 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA