
CAS Number1199-46-8
Synonymsamino-4-tert-butylphenol; 2-amino-4-tert.-butyl-phenol; T-BUTYL-O-AMINOPHENOL; 2-Amino-4-(2-methyl-2-propanyl)phenol; 2-AMINO-4-T-BUTYLPHENOL; 2-HYDROXY-5-TERT-BUTYLANILINE; MFCD00007698; 4-tert-Butyl-2-aminophenol; 2-Amino-4tertutyl plenol; 2-Hydroxy-5-t-butylanilin; p-tert-Butyl-o-aminophenol; o-Amino-p-tert-butylphenol; 2-Amino-4-(tert-butyl)phenol; EINECS 214-844-4; 2-Amino-4-tert-butylphenol; 2-hydroxy-5-tert-butyl-1-aminobenzene
Molecular Formula(CH3)3CC6H3(NH2)OH
Molecular Weight165.23
Purity98%
Density1.1±0.1 g/cm3
Boiling Point274.9±33.0 °C at 760 mmHg
Melting Point160-163 °C (lit.)
Appearancewhite crystal
EINECS214-844-4
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1199-46-8 |
| Catalog No. | 2A-9013244 |
| Chinese Name | 对叔丁基邻氨基苯酚 |
| Synonyms | amino-4-tert-butylphenol; 2-amino-4-tert.-butyl-phenol; T-BUTYL-O-AMINOPHENOL; 2-Amino-4-(2-methyl-2-propanyl)phenol; 2-AMINO-4-T-BUTYLPHENOL; 2-HYDROXY-5-TERT-BUTYLANILINE; MFCD00007698; 4-tert-Butyl-2-aminophenol; 2-Amino-4tertutyl plenol; 2-Hydroxy-5-t-butylanilin; p-tert-Butyl-o-aminophenol; o-Amino-p-tert-butylphenol; 2-Amino-4-(tert-butyl)phenol; EINECS 214-844-4; 2-Amino-4-tert-butylphenol; 2-hydroxy-5-tert-butyl-1-aminobenzene |
| Molecular Formula | (CH3)3CC6H3(NH2)OH |
| Molecular Weight | 165.23 |
| Purity | 98 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 274.9±33.0 °C at 760 mmHg |
| Melting Point | 160-163 °C (lit.) |
| Appearance | white crystal |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| Packaging | I; II; III |
| EINECS | 214-844-4 |
| HTC | 2922299090 |
| PubChem ID | 24851589 |
| MDL Number | MFCD00007698 |
| SMILES | CC(C)(C)c1ccc(O)c(N)c1 |
| InChI | 1S/C10H15NO/c1-10(2,3)7-4-5-9(12)8(11)6-7/h4-6,12H,11H2,1-3H3 |
| InChI Key | RPJUVNYXHUCRMG-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 6.1 |
| MSDS | msds/13244_1_1199_46_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,6-Diisopropylaniline | 24544-04-5 | 2A-9013236 |
| 2,6-Dimethyl-4-heptanone | 108-83-8 | 2A-9013237 |
| 2,6-Dimethylaniline | 87-62-7 | 2A-9013238 |
| 2,6-Dimethylphenol | 576-26-1 | 2A-9013239 |
| 2-Amino-3-methylbenzoic acid | 4389-45-1 | 2A-9013241 |
| 2-Aminobenzoic acid | 118-92-3 | 2A-9013248 |
| 2-Aminoisobutyric acid | 62-57-7 | 2A-9013249 |
| 2-amino-p-cresol | 95-84-1 | 2A-9013250 |
| 2-Aminophenetole | 94-70-2 | 2A-9013251 |
| 2-Aminophenol | 95-55-6 | 2A-9013252 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA